8J53
 
 | |
4DR9
 | | Crystal structure of a peptide deformylase from synechococcus elongatus in complex with actinonin | | Descriptor: | ACTINONIN, BROMIDE ION, Peptide deformylase, ... | | Authors: | Lorimer, D, Abendroth, J, Craig, T, Burgin, A, Segall, A, Rohwler, F. | | Deposit date: | 2012-02-17 | | Release date: | 2013-01-16 | | Last modified: | 2023-09-13 | | Method: | X-RAY DIFFRACTION (1.9 Å) | | Cite: | Structure and function of a cyanophage-encoded peptide deformylase.
ISME J, 7, 2013
|
|
4DRM
 | | EVALUATION OF SYNTHETIC FK506 ANALOGS AS LIGANDS FOR FKBP51 AND FKBP52: COMPLEX OF FKBP51 WITH {3-[(1R)-3-(3,4-dimethoxyphenyl)-1-({[(2S)-1-{[(1S,2R)-2-ethyl-1-hydroxycyclohexyl](oxo)acetyl}piperidin-2-yl]carbonyl}oxy)propyl]phenoxy}acetic acid | | Descriptor: | Peptidyl-prolyl cis-trans isomerase FKBP5, {3-[(1R)-3-(3,4-dimethoxyphenyl)-1-({[(2S)-1-{[(1S,2R)-2-ethyl-1-hydroxycyclohexyl](oxo)acetyl}piperidin-2-yl]carbonyl}oxy)propyl]phenoxy}acetic acid | | Authors: | Gopalakrishnan, R, Kozany, C, Gaali, S, Kress, C, Hoogeland, B, Bracher, A, Hausch, F. | | Deposit date: | 2012-02-17 | | Release date: | 2012-05-16 | | Last modified: | 2023-09-13 | | Method: | X-RAY DIFFRACTION (1.48 Å) | | Cite: | Evaluation of Synthetic FK506 Analogues as Ligands for the FK506-Binding Proteins 51 and 52.
J.Med.Chem., 55, 2012
|
|
8J50
 | |
8J51
 | |
8IVS
 | | crystal structure of SulE mutant | | Descriptor: | Alpha/beta fold hydrolase, GLYCEROL, L(+)-TARTARIC ACID, ... | | Authors: | Liu, B, He, J, Ran, T, Wang, W. | | Deposit date: | 2023-03-28 | | Release date: | 2023-08-02 | | Last modified: | 2024-05-29 | | Method: | X-RAY DIFFRACTION (1.52 Å) | | Cite: | Crystal structures of herbicide-detoxifying esterase reveal a lid loop affecting substrate binding and activity.
Nat Commun, 14, 2023
|
|
8J7J
 | | crystal structure of SulE mutant | | Descriptor: | Alpha/beta fold hydrolase, GLYCEROL, L(+)-TARTARIC ACID, ... | | Authors: | Liu, B, He, J, Ran, T, Wang, W. | | Deposit date: | 2023-04-27 | | Release date: | 2023-08-02 | | Last modified: | 2024-05-29 | | Method: | X-RAY DIFFRACTION (1.54 Å) | | Cite: | Crystal structures of herbicide-detoxifying esterase reveal a lid loop affecting substrate binding and activity.
Nat Commun, 14, 2023
|
|
8IW6
 | | crystal structure of SulE mutant | | Descriptor: | Alpha/beta fold hydrolase, GLYCEROL, L(+)-TARTARIC ACID, ... | | Authors: | Liu, B, He, J, Ran, T, Wang, W. | | Deposit date: | 2023-03-29 | | Release date: | 2023-08-02 | | Last modified: | 2024-05-29 | | Method: | X-RAY DIFFRACTION (1.44 Å) | | Cite: | Crystal structures of herbicide-detoxifying esterase reveal a lid loop affecting substrate binding and activity.
Nat Commun, 14, 2023
|
|
8J52
 | | Crystal structure of Flavihumibacter petaseus GH31 alpha-galactosidase mutant D304A in complex with alpha-1,4-galactobiose | | Descriptor: | 1,2-ETHANEDIOL, CHLORIDE ION, GH31 alpha-galactosidase, ... | | Authors: | Ikegaya, M, Miyazaki, T. | | Deposit date: | 2023-04-21 | | Release date: | 2023-07-26 | | Last modified: | 2023-11-01 | | Method: | X-RAY DIFFRACTION (1.9 Å) | | Cite: | Structure-function analysis of bacterial GH31 alpha-galactosidases specific for alpha-(1→4)-galactobiose.
Febs J., 290, 2023
|
|
8IVM
 | | crystal structure of SulE mutant | | Descriptor: | Alpha/beta fold hydrolase, GLYCEROL, L(+)-TARTARIC ACID, ... | | Authors: | Liu, B, He, J, Ran, T, Wang, W. | | Deposit date: | 2023-03-28 | | Release date: | 2023-08-02 | | Last modified: | 2024-05-29 | | Method: | X-RAY DIFFRACTION (1.32 Å) | | Cite: | Crystal structures of herbicide-detoxifying esterase reveal a lid loop affecting substrate binding and activity.
Nat Commun, 14, 2023
|
|
8IW3
 | | crystal structure of SulE mutant | | Descriptor: | 2-[[[[(4-CHLORO-6-METHOXY-2-PYRIMIDINYL)AMINO]CARBONYL]AMINO]SULFONYL]BENZOIC ACID ETHYL ESTER, Alpha/beta fold hydrolase, GLYCEROL, ... | | Authors: | Liu, B, He, J, Ran, T, Wang, W. | | Deposit date: | 2023-03-29 | | Release date: | 2023-08-02 | | Last modified: | 2024-05-29 | | Method: | X-RAY DIFFRACTION (1.56 Å) | | Cite: | Crystal structures of herbicide-detoxifying esterase reveal a lid loop affecting substrate binding and activity.
Nat Commun, 14, 2023
|
|
6LP5
 | | Structure of Sinonovacula constricta ferritin | | Descriptor: | FE (II) ION, FE (III) ION, Ferritin, ... | | Authors: | Su, X.R, Ming, T.H, Su, C. | | Deposit date: | 2020-01-08 | | Release date: | 2020-04-08 | | Last modified: | 2023-11-29 | | Method: | X-RAY DIFFRACTION (1.98 Å) | | Cite: | Crystallographic characterization of ferritin from Sinonovacula constricta.
Biochem.Biophys.Res.Commun., 524, 2020
|
|
8J7K
 | | crystal structure of SulE mutant | | Descriptor: | Alpha/beta fold hydrolase, GLYCEROL, L(+)-TARTARIC ACID, ... | | Authors: | Liu, B, He, J, Ran, T, Wang, W. | | Deposit date: | 2023-04-27 | | Release date: | 2023-08-02 | | Last modified: | 2024-05-29 | | Method: | X-RAY DIFFRACTION (1.36 Å) | | Cite: | Crystal structures of herbicide-detoxifying esterase reveal a lid loop affecting substrate binding and activity.
Nat Commun, 14, 2023
|
|
8IVE
 | | crystal structure of SulE mutant | | Descriptor: | 2-[[[[(4-CHLORO-6-METHOXY-2-PYRIMIDINYL)AMINO]CARBONYL]AMINO]SULFONYL]BENZOIC ACID ETHYL ESTER, Alpha/beta fold hydrolase, GLYCEROL | | Authors: | Liu, B, He, J, Ran, T, Wang, W. | | Deposit date: | 2023-03-27 | | Release date: | 2023-08-02 | | Last modified: | 2024-05-29 | | Method: | X-RAY DIFFRACTION (1.44 Å) | | Cite: | Crystal structures of herbicide-detoxifying esterase reveal a lid loop affecting substrate binding and activity.
Nat Commun, 14, 2023
|
|
4DPC
 | | The 1.06 Angstrom crystal structure of reduced (CuI) poplar plastocyanin A at pH 8.0 | | Descriptor: | COPPER (I) ION, Plastocyanin A, chloroplastic | | Authors: | Kachalova, G.S, Shosheva, A.H, Bourenkov, G.P, Donchev, A.A, Dimitrov, M.I, Bartunik, H.D. | | Deposit date: | 2012-02-13 | | Release date: | 2013-02-13 | | Last modified: | 2023-09-13 | | Method: | X-RAY DIFFRACTION (1.06 Å) | | Cite: | Structural comparison of the poplar plastocyanin isoforms PCa and PCb sheds new light on the role of the copper site geometry in interactions with redox partners in oxygenic photosynthesis.
J.Inorg.Biochem., 115, 2012
|
|
8IVN
 | | crystal structure of SulE mutant | | Descriptor: | Alpha/beta fold hydrolase, GLYCEROL, L(+)-TARTARIC ACID, ... | | Authors: | Liu, B, He, J, Ran, T, Wang, W. | | Deposit date: | 2023-03-28 | | Release date: | 2023-08-02 | | Last modified: | 2024-05-29 | | Method: | X-RAY DIFFRACTION (1.5 Å) | | Cite: | Crystal structures of herbicide-detoxifying esterase reveal a lid loop affecting substrate binding and activity.
Nat Commun, 14, 2023
|
|
8IVT
 | | crystal structure of SulE mutant | | Descriptor: | Alpha/beta fold hydrolase, GLYCEROL, L(+)-TARTARIC ACID, ... | | Authors: | Liu, B, He, J, Ran, T, Wang, W. | | Deposit date: | 2023-03-28 | | Release date: | 2023-08-02 | | Last modified: | 2024-05-29 | | Method: | X-RAY DIFFRACTION (1.42 Å) | | Cite: | Crystal structures of herbicide-detoxifying esterase reveal a lid loop affecting substrate binding and activity.
Nat Commun, 14, 2023
|
|
8J7G
 | | crystal structure of SulE mutant | | Descriptor: | Alpha/beta fold hydrolase, GLYCEROL, L(+)-TARTARIC ACID, ... | | Authors: | Liu, B, He, J, Ran, T, Wang, W. | | Deposit date: | 2023-04-27 | | Release date: | 2023-08-02 | | Last modified: | 2024-05-29 | | Method: | X-RAY DIFFRACTION (1.63 Å) | | Cite: | Crystal structures of herbicide-detoxifying esterase reveal a lid loop affecting substrate binding and activity.
Nat Commun, 14, 2023
|
|
8IMZ
 | | Cryo-EM structure of mouse Piezo1-MDFIC complex (composite map) | | Descriptor: | MyoD family inhibitor domain-containing protein, Piezo-type mechanosensitive ion channel component 1 | | Authors: | Zhou, Z, Ma, X, Lin, Y, Cheng, D, Bavi, N, Li, J.V, Sutton, D, Yao, M, Harvey, N, Corry, B, Zhang, Y, Cox, C.D. | | Deposit date: | 2023-03-07 | | Release date: | 2023-08-09 | | Last modified: | 2023-08-30 | | Method: | ELECTRON MICROSCOPY (3.66 Å) | | Cite: | MyoD-family inhibitor proteins act as auxiliary subunits of Piezo channels.
Science, 381, 2023
|
|
4DVT
 | | Crystal structure of clade A/E 93TH057 HIV-1 gp120 core in complex with AS-II-37 | | Descriptor: | 2-acetamido-2-deoxy-beta-D-glucopyranose, 4-(2-HYDROXYETHYL)-1-PIPERAZINE ETHANESULFONIC ACID, N-(4-chloro-3-fluorophenyl)-N'-[(1S)-1,2,3,4-tetrahydroisoquinolin-1-ylmethyl]ethanediamide, ... | | Authors: | Kwon, Y.D, Kwong, P.D. | | Deposit date: | 2012-02-23 | | Release date: | 2013-02-27 | | Last modified: | 2024-11-27 | | Method: | X-RAY DIFFRACTION (2.4 Å) | | Cite: | Crystal Structures of HIV-1 gp120 Envelope Glycoprotein in Complex with NBD Analogues That Target the CD4-Binding Site.
Plos One, 9, 2014
|
|
4DVX
 | | Crystal structure of clade A/E 93TH057 HIV-1 gp120 core in complex with MAE-II-188 | | Descriptor: | 2-acetamido-2-deoxy-beta-D-glucopyranose, 4-(2-HYDROXYETHYL)-1-PIPERAZINE ETHANESULFONIC ACID, N-(4-chloro-3-fluorophenyl)-N'-{[(3R)-1-cyclopropylpyrrolidin-3-yl]methyl}ethanediamide, ... | | Authors: | Kwon, Y.D, Kwong, P.D. | | Deposit date: | 2012-02-23 | | Release date: | 2013-02-27 | | Last modified: | 2024-10-16 | | Method: | X-RAY DIFFRACTION (2.4 Å) | | Cite: | Crystal Structures of HIV-1 gp120 Envelope Glycoprotein in Complex with NBD Analogues That Target the CD4-Binding Site.
Plos One, 9, 2014
|
|
6MD8
 | | Crystal structure of CTX-M-14 with compound 3 | | Descriptor: | 1-(2,4-dichlorophenyl)-4-(1H-tetrazol-5-yl)-1H-pyrazol-5-amine, Beta-lactamase CTX-M-14, DIMETHYL SULFOXIDE | | Authors: | Akhtar, A, Chen, Y. | | Deposit date: | 2018-09-04 | | Release date: | 2019-04-17 | | Last modified: | 2024-10-23 | | Method: | X-RAY DIFFRACTION (1.4 Å) | | Cite: | Active-Site Druggability of Carbapenemases and Broad-Spectrum Inhibitor Discovery.
Acs Infect Dis., 5, 2019
|
|
4DB2
 | | Mss116p DEAD-box helicase domain 2 bound to an RNA duplex | | Descriptor: | 5'-R(*GP*GP*GP*CP*GP*GP*GP*CP*CP*CP*GP*CP*CP*C)-3', ATP-dependent RNA helicase MSS116, mitochondrial | | Authors: | Mallam, A.L, Del Campo, M, Gilman, B.D, Sidote, D.J, Lambowitz, A. | | Deposit date: | 2012-01-13 | | Release date: | 2012-08-29 | | Last modified: | 2023-09-13 | | Method: | X-RAY DIFFRACTION (3.157 Å) | | Cite: | Structural basis for RNA-duplex recognition and unwinding by the DEAD-box helicase Mss116p.
Nature, 490, 2012
|
|
2A1H
 | | X-ray crystal structure of human mitochondrial branched chain aminotransferase (BCATm) complexed with gabapentin | | Descriptor: | ACETIC ACID, PYRIDOXAL-5'-PHOSPHATE, [1-(AMINOMETHYL)CYCLOHEXYL]ACETIC ACID, ... | | Authors: | Goto, M, Miyahara, I, Hirotsu, K, Conway, M, Yennawar, N, Islam, M.M, Hutson, S.M. | | Deposit date: | 2005-06-20 | | Release date: | 2005-09-06 | | Last modified: | 2025-03-26 | | Method: | X-RAY DIFFRACTION (1.8 Å) | | Cite: | Structural determinants for branched-chain aminotransferase isozyme-specific inhibition by the anticonvulsant drug gabapentin.
J.Biol.Chem., 280, 2005
|
|
8JBM
 | | Crystal structure of Na+,K+-ATPase in the E1.Mn2+ state | | Descriptor: | 1,2-DIACYL-SN-GLYCERO-3-PHOSPHOCHOLINE, 1,2-DIOLEOYL-SN-GLYCERO-3-PHOSPHOCHOLINE, 2-acetamido-2-deoxy-beta-D-glucopyranose, ... | | Authors: | Kanai, R, Vilsen, B, Cornelius, F, Toyoshima, C. | | Deposit date: | 2023-05-09 | | Release date: | 2023-08-09 | | Last modified: | 2024-11-20 | | Method: | X-RAY DIFFRACTION (2.9 Å) | | Cite: | Crystal structures of Na + ,K + -ATPase reveal the mechanism that converts the K + -bound form to Na + -bound form and opens and closes the cytoplasmic gate.
Febs Lett., 597, 2023
|
|
