2C8S
 
 | | CYTOCHROME CL FROM METHYLOBACTERIUM EXTORQUENS | | Descriptor: | CALCIUM ION, CYTOCHROME C-L, PROTOPORPHYRIN IX CONTAINING FE | | Authors: | Williams, P.A, Coates, L, Mohammed, F, Gill, R, Erskine, P.T, Wood J, S.P, Cooper, B, Anthony, C. | | Deposit date: | 2005-12-06 | | Release date: | 2005-12-08 | | Last modified: | 2024-11-13 | | Method: | X-RAY DIFFRACTION (1.6 Å) | | Cite: | The 1.6A X-Ray Structure of the Unusual C-Type Cytochrome, Cytochrome Cl, from the Methylotrophic Bacterium Methylobacterium Extorquens.
J.Mol.Biol., 357, 2006
|
|
2EO2
 | | Solution structure of the insertion region (510-573) of FTHFS domain from mouse methylenetetrahydrofolate dehydrogenase (NADP+ dependent) 1-like protein | | Descriptor: | Adult male hypothalamus cDNA, RIKEN full-length enriched library, clone:A230045M11 product:weakly similar to C1-tetrahydrofolate synthase | | Authors: | Kurosaki, C, Nagashima, T, Yoshida, M, Hayashi, F, Yokoyama, S, RIKEN Structural Genomics/Proteomics Initiative (RSGI) | | Deposit date: | 2007-03-28 | | Release date: | 2007-10-02 | | Last modified: | 2024-05-29 | | Method: | SOLUTION NMR | | Cite: | Solution structure of the insertion region (510-573) of FTHFS domain from mouse methylenetetrahydrofolate dehydrogenase (NADP+ dependent) 1-like protein
To be Published
|
|
2HPF
 | |
2I5U
 | | Crystal structure of DnaD domain protein from Enterococcus faecalis. Structural genomics target APC85179 | | Descriptor: | DnaD domain protein, MAGNESIUM ION | | Authors: | Wu, R, Zhang, R, Bargassa, M, Joachimiak, A, Midwest Center for Structural Genomics (MCSG) | | Deposit date: | 2006-08-25 | | Release date: | 2006-11-07 | | Last modified: | 2024-11-13 | | Method: | X-RAY DIFFRACTION (1.5 Å) | | Cite: | 1.5 A crystal structure of a DnaD domain protein from Enterococcus Faecalis
To be Published, 2006
|
|
9CEK
 | | SARS-CoV-2 3CL Protease complexed with covalent inhibitor VK20 | | Descriptor: | 3C-like proteinase nsp5, L(+)-TARTARIC ACID, N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]-4-methoxy-1H-indole-2-carboxamide, ... | | Authors: | Hoffpauir, Z.A, Meneely, K.M, Lamb, A.L. | | Deposit date: | 2024-06-26 | | Release date: | 2025-01-15 | | Last modified: | 2025-01-22 | | Method: | X-RAY DIFFRACTION (1.38 Å) | | Cite: | Dual Inhibitors of SARS-CoV-2 3CL Protease and Human Cathepsin L Containing Glutamine Isosteres Are Anti-CoV-2 Agents.
J.Am.Chem.Soc., 147, 2025
|
|
6PAI
 | |
5SSN
 | |
5WZS
 | | Crystal structure of human secreted phospholipase A2 group IIE with Compound 8 | | Descriptor: | 2-[2-methyl-1-(naphthalen-1-ylmethyl)-3-oxamoyl-indol-4-yl]oxyethanoic acid, CALCIUM ION, CHLORIDE ION, ... | | Authors: | Hou, S, Xu, J, Xu, T, Liu, J. | | Deposit date: | 2017-01-18 | | Release date: | 2018-01-24 | | Last modified: | 2024-11-13 | | Method: | X-RAY DIFFRACTION (2.3 Å) | | Cite: | Structural basis for functional selectivity and ligand recognition revealed by crystal structures of human secreted phospholipase A2 group IIE
Sci Rep, 7, 2017
|
|
4EP5
 | | Thermus thermophilus RuvC structure | | Descriptor: | Crossover junction endodeoxyribonuclease RuvC, GLYCEROL, SULFATE ION | | Authors: | Chen, L, Shi, K, Yin, Z.Q, Aihara, H. | | Deposit date: | 2012-04-17 | | Release date: | 2012-11-14 | | Last modified: | 2024-02-28 | | Method: | X-RAY DIFFRACTION (2.08 Å) | | Cite: | Structural asymmetry in the Thermus thermophilus RuvC dimer suggests a basis for sequential strand cleavages during Holliday junction resolution.
Nucleic Acids Res., 41, 2013
|
|
5SOM
 | |
5IS9
 | | Crystal structure of mouse CARM1 in complex with inhibitor SA0375 | | Descriptor: | (2S)-2-amino-4-[(3-{4-[(2S)-2-amino-2-carboxyethyl]-1H-1,2,3-triazol-1-yl}propyl){[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl]methyl}amino]butanoic acid (non-preferred name), 1,2-DIMETHOXYETHANE, 1,2-ETHANEDIOL, ... | | Authors: | Cura, V, Marechal, N, Mailliot, J, Troffer-Charlier, N, Hassenboehler, P, Wurtz, J.M, Bonnefond, L, Cavarelli, J. | | Deposit date: | 2016-03-15 | | Release date: | 2017-03-15 | | Last modified: | 2024-01-10 | | Method: | X-RAY DIFFRACTION (2.4 Å) | | Cite: | Crystal structure of mouse CARM1 in complex with inhibitor SA0375
To Be Published
|
|
5SOJ
 | |
7OHR
 | | Nog1-TAP associated immature ribosomal particle population E from S. cerevisiae | | Descriptor: | 25S rRNA, 25S rRNA (cytosine(2870)-C(5))-methyltransferase, 27S pre-rRNA (guanosine(2922)-2'-O)-methyltransferase, ... | | Authors: | Milkereit, P, Poell, G. | | Deposit date: | 2021-05-11 | | Release date: | 2021-11-10 | | Last modified: | 2024-07-10 | | Method: | ELECTRON MICROSCOPY (4.72 Å) | | Cite: | Analysis of subunit folding contribution of three yeast large ribosomal subunit proteins required for stabilisation and processing of intermediate nuclear rRNA precursors.
Plos One, 16, 2021
|
|
5SOK
 | |
6SRU
 | | Structure of Ig-like V-type domian of mouse Programmed cell death 1 ligand 1 (PD-L1) | | Descriptor: | Programmed cell death 1 ligand 1 | | Authors: | Magiera-Mularz, K, Sala, D, Grudnik, P, Holak, T.A. | | Deposit date: | 2019-09-06 | | Release date: | 2021-02-03 | | Last modified: | 2024-10-23 | | Method: | X-RAY DIFFRACTION (2.532 Å) | | Cite: | Human and mouse PD-L1: similar molecular structure, but different druggability profiles.
Iscience, 24, 2021
|
|
6SXX
 | | Crystal structure of the bromodomain of human CREBBP in complex with ACA007 | | Descriptor: | (3~{R})-1-ethanoylpyrrolidine-3-carboxylic acid, 1,2-ETHANEDIOL, CREBBP | | Authors: | Xiang, W, Bedi, R.K, Sledz, P, Caflisch, A. | | Deposit date: | 2019-09-26 | | Release date: | 2020-07-29 | | Last modified: | 2024-01-24 | | Method: | X-RAY DIFFRACTION (2.01 Å) | | Cite: | Crystal structure of the bromodomain of human CREBBP in complex with ACA007
To Be Published
|
|
7QZR
 | |
5SFE
 | | CRYSTAL STRUCTURE OF HUMAN PHOSPHODIESTERASE 10 IN COMPLEX WITH c2(nc1nc(cn1cc2)c3cc(ccc3)F)NC(c4c(cnn4C)C(N(C)C)=O)=O, micromolar IC50=0.011191 | | Descriptor: | MAGNESIUM ION, N~5~-[(2P,4S)-2-(3-fluorophenyl)imidazo[1,2-a]pyrimidin-7-yl]-N~4~,N~4~,1-trimethyl-1H-pyrazole-4,5-dicarboxamide, ZINC ION, ... | | Authors: | Joseph, C, Gobbi, L, Benz, J, Schlatter, D, Rudolph, M.G. | | Deposit date: | 2022-01-21 | | Release date: | 2022-10-19 | | Last modified: | 2024-10-16 | | Method: | X-RAY DIFFRACTION (1.86 Å) | | Cite: | Crystal Structure of a human phosphodiesterase 10 complex
To be published
|
|
2VD1
 | | Complex structure of prostaglandin D2 synthase at 2.25A. | | Descriptor: | 4-{[4-(4-fluoro-3-methylphenyl)-1,3-thiazol-2-yl]amino}-2-hydroxybenzoic acid, GLUTATHIONE, GLUTATHIONE-REQUIRING PROSTAGLANDIN D SYNTHASE, ... | | Authors: | Hohwy, M, Spadola, L, Lundquist, B, von Wachenfeldt, K, Persdotter, S, Hawtin, P, Dahmen, J, Groth-Clausen, I, Folmer, R.H.A, Edman, K. | | Deposit date: | 2007-09-28 | | Release date: | 2008-04-15 | | Last modified: | 2023-12-13 | | Method: | X-RAY DIFFRACTION (2.25 Å) | | Cite: | Novel Prostaglandin D Synthase Inhibitors Generated by Fragment-Based Drug Design.
J.Med.Chem., 51, 2008
|
|
4AYI
 | | Structure of a complex between CCPs 6 and 7 of Human Complement Factor H and Neisseria meningitidis FHbp Variant 3 Wild type | | Descriptor: | 1,2-ETHANEDIOL, COMPLEMENT FACTOR H, LIPOPROTEIN GNA1870 CCOMPND 7 | | Authors: | Johnson, S, Tan, L, van der Veen, S, Caesar, J, Goicoechea De Jorge, E, Everett, R.J, Bai, X, Exley, R.M, Ward, P.N, Ruivo, N, Trivedi, K, Cumber, E, Jones, R, Newham, L, Staunton, D, Borrow, R, Pickering, M, Lea, S.M, Tang, C.M. | | Deposit date: | 2012-06-21 | | Release date: | 2012-11-07 | | Last modified: | 2024-10-23 | | Method: | X-RAY DIFFRACTION (2.31 Å) | | Cite: | Design and Evaluation of Meningococcal Vaccines Through Structure-Based Modification of Host and Pathogen Molecules.
Plos Pathog., 8, 2012
|
|
3DCF
 | |
5SDU
 | | CRYSTAL STRUCTURE OF HUMAN PHOSPHODIESTERASE 10 IN COMPLEX WITH c1(c(oc(n1)c2ccccc2)C)CCc3nc(cn3C)c4ccccc4, micromolar IC50=0.046796 | | Descriptor: | 5-methyl-4-[2-(1-methyl-4-phenyl-1H-imidazol-2-yl)ethyl]-2-phenyl-1,3-oxazole, MAGNESIUM ION, ZINC ION, ... | | Authors: | Joseph, C, Groebke-Zbinden, K, Benz, J, Schlatter, D, Rudolph, M.G. | | Deposit date: | 2022-01-21 | | Release date: | 2022-10-12 | | Last modified: | 2024-10-16 | | Method: | X-RAY DIFFRACTION (2.15 Å) | | Cite: | A high quality, industrial data set for binding affinity prediction: performance comparison in different early drug discovery scenarios.
J.Comput.Aided Mol.Des., 36, 2022
|
|
3HA6
 | | Crystal structure of aurora A in complex with TPX2 and compound 10 | | Descriptor: | N~2~-(3,4-dimethoxyphenyl)-N~4~-[2-(2-fluorophenyl)ethyl]-N~6~-quinolin-6-yl-1,3,5-triazine-2,4,6-triamine, Serine/threonine-protein kinase 6, Targeting protein for Xklp2 | | Authors: | Zhao, B, Clark, M.A. | | Deposit date: | 2009-05-01 | | Release date: | 2009-08-04 | | Last modified: | 2024-10-16 | | Method: | X-RAY DIFFRACTION (2.36 Å) | | Cite: | Design, synthesis and selection of DNA-encoded small-molecule libraries.
Nat.Chem.Biol., 5, 2009
|
|
4IOO
 | | Crystal Structure of the first bromodomain of BRD4 in complex with N-methyltrimethylacetamide | | Descriptor: | 1,2-ETHANEDIOL, Bromodomain-containing protein 4, DIMETHYL SULFOXIDE, ... | | Authors: | Lolli, G, Battistutta, R. | | Deposit date: | 2013-01-08 | | Release date: | 2013-10-02 | | Last modified: | 2024-02-28 | | Method: | X-RAY DIFFRACTION (1.25 Å) | | Cite: | Different orientations of low-molecular-weight fragments in the binding pocket of a BRD4 bromodomain.
Acta Crystallogr.,Sect.D, 69, 2013
|
|
1FYW
 | | CRYSTAL STRUCTURE OF THE TIR DOMAIN OF HUMAN TLR2 | | Descriptor: | TOLL-LIKE RECEPTOR 2 | | Authors: | Xu, Y, Tao, X, Shen, B, Horng, T, Medzhitov, R, Manley, J.L, Tong, L, Northeast Structural Genomics Consortium (NESG) | | Deposit date: | 2000-10-03 | | Release date: | 2000-11-22 | | Last modified: | 2024-11-13 | | Method: | X-RAY DIFFRACTION (3 Å) | | Cite: | Structural basis for signal transduction by the Toll/interleukin-1 receptor domains.
Nature, 408, 2000
|
|
