4IMG
 
 | |
2JO0
 | | The solution structure of the monomeric species of the C terminal domain of the CA protein of HIV-1 | | Descriptor: | Gag-Pol polyprotein | | Authors: | Alcaraz, L.A, del Alamo, M, Barrera, F.N, Mateu, M.G, Neira, J.L. | | Deposit date: | 2007-02-17 | | Release date: | 2007-07-31 | | Last modified: | 2023-12-20 | | Method: | SOLUTION NMR | | Cite: | Flexibility in HIV-1 Assembly Subunits: Solution Structure of the Monomeric C-Terminal Domain of the Capsid Protein
Biophys.J., 93, 2007
|
|
4INI
 | | Human Histidine Triad Nucleotide Binding Protein 2 with Bound AMP | | Descriptor: | 1-METHOXY-2-[2-(2-METHOXY-ETHOXY]-ETHANE, ADENOSINE MONOPHOSPHATE, DI(HYDROXYETHYL)ETHER, ... | | Authors: | Maize, K.M, Wagner, C.R, Finzel, B.C. | | Deposit date: | 2013-01-04 | | Release date: | 2013-05-22 | | Last modified: | 2023-09-20 | | Method: | X-RAY DIFFRACTION (1.65 Å) | | Cite: | Structural characterization of human histidine triad nucleotide-binding protein 2, a member of the histidine triad superfamily.
Febs J., 280, 2013
|
|
1RHH
 | | Crystal Structure of the Broadly HIV-1 Neutralizing Fab X5 at 1.90 Angstrom Resolution | | Descriptor: | Fab X5, heavy chain, light chain | | Authors: | Darbha, R, Phogat, S, Labrijn, A.F, Shu, Y, Gu, Y, Andrykovitch, M, Zhang, M.Y, Pantophlet, R, Martin, L, Vita, C, Burton, D.R, Dimitrov, D.S, Ji, X. | | Deposit date: | 2003-11-14 | | Release date: | 2004-02-24 | | Last modified: | 2024-11-20 | | Method: | X-RAY DIFFRACTION (1.9 Å) | | Cite: | Crystal Structure of the Broadly Cross-Reactive HIV-1-Neutralizing Fab X5 and Fine Mapping of Its Epitope
Biochemistry, 43, 2004
|
|
2E5P
 | | Solution structure of the TUDOR domain of PHD finger protein 1 (PHF1 protein) | | Descriptor: | PHD finger protein 1 | | Authors: | Dang, W, Muto, Y, Inoue, M, Kigawa, T, Shirouzu, M, Terada, T, Yokoyama, S, RIKEN Structural Genomics/Proteomics Initiative (RSGI) | | Deposit date: | 2006-12-22 | | Release date: | 2007-06-26 | | Last modified: | 2024-05-29 | | Method: | SOLUTION NMR | | Cite: | Solution structure of the TUDOR domain of PHD finger protein 1 (PHF1 protein)
To be Published
|
|
260L
 | | AN ADAPTABLE METAL-BINDING SITE ENGINEERED INTO T4 LYSOZYME | | Descriptor: | CHLORIDE ION, NICKEL (II) ION, PROTEIN (LYSOZYME) | | Authors: | Wray, J.W, Baase, W.A, Ostheimer, G.J, Matthews, B.W. | | Deposit date: | 1999-03-01 | | Release date: | 2000-09-11 | | Last modified: | 2023-12-27 | | Method: | X-RAY DIFFRACTION (1.8 Å) | | Cite: | Use of a non-rigid region in T4 lysozyme to design an adaptable metal-binding site.
Protein Eng., 13, 2000
|
|
1TAD
 | | GTPASE MECHANISM OF GPROTEINS FROM THE 1.7-ANGSTROM CRYSTAL STRUCTURE OF TRANSDUCIN ALPHA-GDP-ALF4- | | Descriptor: | CACODYLATE ION, CALCIUM ION, GUANOSINE-5'-DIPHOSPHATE, ... | | Authors: | Sondek, J, Lambright, D.G, Noel, J.P, Hamm, H.E, Sigler, P.B. | | Deposit date: | 1995-01-05 | | Release date: | 1995-05-08 | | Last modified: | 2024-02-14 | | Method: | X-RAY DIFFRACTION (1.7 Å) | | Cite: | GTPase mechanism of Gproteins from the 1.7-A crystal structure of transducin alpha-GDP-AIF-4.
Nature, 372, 1994
|
|
1E7Q
 | | GDP 4-keto-6-deoxy-D-mannose epimerase reductase S107A | | Descriptor: | 2-AMINO-2-HYDROXYMETHYL-PROPANE-1,3-DIOL, ACETYLPHOSPHATE, GDP-FUCOSE SYNTHETASE, ... | | Authors: | Rosano, C, Izzo, G, Bolognesi, M. | | Deposit date: | 2000-09-07 | | Release date: | 2000-10-18 | | Last modified: | 2023-12-13 | | Method: | X-RAY DIFFRACTION (1.6 Å) | | Cite: | Probing the Catalytic Mechanism of Gdp-4-Keto-6-Deoxy-D-Mannose Epimerase/Reductase by Kinetic and Crystallographic Characterization of Site-Specific Mutants
J.Mol.Biol., 303, 2000
|
|
4K1R
 | |
2EQU
 | | Solution structure of the tudor domain of PHD finger protein 20-like 1 | | Descriptor: | PHD finger protein 20-like 1 | | Authors: | Futami, K, Suzuki, S, Muto, Y, Inoue, M, Kigawa, T, Terada, T, Shirouzu, M, Yokoyama, S, RIKEN Structural Genomics/Proteomics Initiative (RSGI) | | Deposit date: | 2007-03-30 | | Release date: | 2007-10-02 | | Last modified: | 2024-05-29 | | Method: | SOLUTION NMR | | Cite: | Solution structure of the tudor domain of PHD finger protein 20-like 1
To be Published
|
|
3V8H
 | |
3VAL
 | | Structure of U2AF65 variant with BrU5C1 DNA | | Descriptor: | 1,4-DIETHYLENE DIOXIDE, DNA (5'-D(*C*UP*UP*UP*(BRU)P*UP*U)-3'), SULFATE ION, ... | | Authors: | Jenkins, J.L, Frato, K.H, Kielkopf, C.L. | | Deposit date: | 2011-12-29 | | Release date: | 2013-02-13 | | Last modified: | 2023-09-13 | | Method: | X-RAY DIFFRACTION (2.5 Å) | | Cite: | U2AF65 adapts to diverse pre-mRNA splice sites through conformational selection of specific and promiscuous RNA recognition motifs.
Nucleic Acids Res., 41, 2013
|
|
5SHL
 | | CRYSTAL STRUCTURE OF HUMAN PHOSPHODIESTERASE 10 IN COMPLEX WITH c1(cc(nn2c1nc(c2C)C)Cl)N3CCCC3, micromolar IC50=1.188091 | | Descriptor: | (4R)-6-chloro-2,3-dimethyl-8-(pyrrolidin-1-yl)imidazo[1,2-b]pyridazine, MAGNESIUM ION, ZINC ION, ... | | Authors: | Joseph, C, Benz, J, Flohr, A, Groebke-Zbinden, K, Rudolph, M.G. | | Deposit date: | 2022-02-01 | | Release date: | 2022-10-12 | | Last modified: | 2024-10-16 | | Method: | X-RAY DIFFRACTION (2.35 Å) | | Cite: | Crystal Structure of a human phosphodiesterase 10 complex
To be published
|
|
1EKK
 | | CRYSTAL STRUCTURE OF HYDROXYETHYLTHIAZOLE KINASE IN THE R3 FORM WITH HYDROXYETHYLTHIAZOLE | | Descriptor: | 2-(4-METHYL-THIAZOL-5-YL)-ETHANOL, HYDROXYETHYLTHIAZOLE KINASE, SULFUR DIOXIDE | | Authors: | Campobasso, N, Mathews, I.I, Begley, T.P, Ealick, S.E. | | Deposit date: | 2000-03-09 | | Release date: | 2000-08-09 | | Last modified: | 2024-10-30 | | Method: | X-RAY DIFFRACTION (2 Å) | | Cite: | Crystal structure of 4-methyl-5-beta-hydroxyethylthiazole kinase from Bacillus subtilis at 1.5 A resolution.
Biochemistry, 39, 2000
|
|
1E6U
 | | GDP 4-keto-6-deoxy-D-mannose epimerase reductase | | Descriptor: | 2-AMINO-2-HYDROXYMETHYL-PROPANE-1,3-DIOL, ACETYLPHOSPHATE, GDP-FUCOSE SYNTHETASE, ... | | Authors: | Rosano, C, Izzo, G, Bolognesi, M. | | Deposit date: | 2000-08-23 | | Release date: | 2000-10-22 | | Last modified: | 2025-10-01 | | Method: | X-RAY DIFFRACTION (1.45 Å) | | Cite: | Probing the Catalytic Mechanism of Gdp-4-Keto-6-Deoxy-D-Mannose Epimerase/Reductase by Kinetic and Crystallographic Characterization of Site-Specific Mutants
J.Mol.Biol., 303, 2000
|
|
1ZYX
 | | Crystal structure of the complex of a group IIA phospholipase A2 with a synthetic anti-inflammatory agent licofelone at 1.9A resolution | | Descriptor: | Phospholipase A2 VRV-PL-VIIIa, SULFATE ION, [6-(4-CHLOROPHENYL)-2,2-DIMETHYL-7-PHENYL-2,3-DIHYDRO-1H-PYRROLIZIN-5-YL]ACETIC ACID | | Authors: | Singh, N, Jabeen, T, Sharma, S, Bhushan, A, Singh, T.P. | | Deposit date: | 2005-06-13 | | Release date: | 2005-06-28 | | Last modified: | 2024-11-13 | | Method: | X-RAY DIFFRACTION (1.95 Å) | | Cite: | Crystal structure of the complex of a group IIA phospholipase A2 with a synthetic anti-inflammatory agent licofelone at 1.9A resolution
To be Published
|
|
4KIW
 | | Design and structural analysis of aromatic inhibitors of type II dehydroquinate dehydratase from Mycobacterium tuberculosis - compound 49e [5-[(3-nitrobenzyl)amino]benzene-1,3-dicarboxylic acid] | | Descriptor: | 3-dehydroquinate dehydratase, 5-[(3-nitrobenzyl)amino]benzene-1,3-dicarboxylic acid | | Authors: | Dias, M.V.B, Howard, N.G, Blundell, T.L, Abell, C. | | Deposit date: | 2013-05-02 | | Release date: | 2014-05-14 | | Last modified: | 2024-02-28 | | Method: | X-RAY DIFFRACTION (2.57 Å) | | Cite: | Design and Structural Analysis of Aromatic Inhibitors of Type II Dehydroquinase from Mycobacterium tuberculosis.
Chemmedchem, 10, 2015
|
|
3VEO
 | | Crystal structure of the O-carbamoyltransferase TobZ in complex with carbamoyl phosphate | | Descriptor: | 1,2-ETHANEDIOL, FE (II) ION, O-carbamoyltransferase TobZ, ... | | Authors: | Parthier, C, Stubbs, M.T, Goerlich, S, Jaenecke, F. | | Deposit date: | 2012-01-09 | | Release date: | 2012-01-25 | | Last modified: | 2023-09-13 | | Method: | X-RAY DIFFRACTION (2.187 Å) | | Cite: | The O-Carbamoyltransferase TobZ Catalyzes an Ancient Enzymatic Reaction.
Angew.Chem.Int.Ed.Engl., 51, 2012
|
|
4KPD
 | | Crystal Structure of Human Farnesyl Pyrophosphate Synthase (Y204F) Mutant Complexed with Mg, Risedronate and Isopentenyl Pyrophosphate | | Descriptor: | 1-HYDROXY-2-(3-PYRIDINYL)ETHYLIDENE BIS-PHOSPHONIC ACID, 3-METHYLBUT-3-ENYL TRIHYDROGEN DIPHOSPHATE, Farnesyl pyrophosphate synthase, ... | | Authors: | Barnett, B.L, Tsoumpra, M.K, Muniz, J.R.C, Walter, R.L. | | Deposit date: | 2013-05-13 | | Release date: | 2014-04-30 | | Last modified: | 2023-09-20 | | Method: | X-RAY DIFFRACTION (1.96 Å) | | Cite: | Crystal Structure of Human Farnesyl Pyrophosphate Synthase (Y204F) Mutant Complexed with Mg, Risedronate and Isopentenyl Pyrophosphate
To be Published
|
|
2JFM
 | | CRYSTAL STRUCTURE OF HUMAN STE20-LIKE KINASE (UNLIGANDED FORM) | | Descriptor: | 1,2-ETHANEDIOL, STE20-LIKE SERINE-THREONINE KINASE | | Authors: | Pike, A.C.W, Rellos, P, Fedorov, O, Keates, T, Salah, E, Savitsky, P, Papagrigoriou, E, Bunkoczi, G, von Delft, F, Arrowsmith, C.H, Edwards, A, Weigelt, J, Sundstrom, M, Knapp, S. | | Deposit date: | 2007-02-02 | | Release date: | 2007-02-27 | | Last modified: | 2024-11-20 | | Method: | X-RAY DIFFRACTION (2.85 Å) | | Cite: | Activation Segment Dimerization: A Mechanism for Kinase Autophosphorylation of Non-Consensus Sites.
Embo J., 27, 2008
|
|
1VLZ
 | |
3AQC
 | | M. luteus B-P 26 heterodimeric hexaprenyl diphosphate synthase in complex with magnesium and FPP analogue | | Descriptor: | (2E,6E)-7,11-dimethyldodeca-2,6,10-trien-1-yl trihydrogen diphosphate, CHLORIDE ION, Component A of hexaprenyl diphosphate synthase, ... | | Authors: | Sasaki, D, Fujihashi, M, Okuyama, N, Kobayashi, Y, Noike, M, Koyama, T, Miki, K. | | Deposit date: | 2010-10-28 | | Release date: | 2010-11-10 | | Last modified: | 2024-03-13 | | Method: | X-RAY DIFFRACTION (2.61 Å) | | Cite: | Crystal structure of heterodimeric hexaprenyl diphosphate synthase from Micrococcus luteus B-P 26 reveals that the small subunit is directly involved in the product chain length regulation.
J.Biol.Chem., 286, 2011
|
|
3ASL
 | | Structure of UHRF1 in complex with histone tail | | Descriptor: | 1,2-ETHANEDIOL, E3 ubiquitin-protein ligase UHRF1, Histone H3.3, ... | | Authors: | Arita, K, Sugita, K, Unoki, M, Hamamoto, R, Sekiyama, N, Tochio, H, Ariyoshi, M, Shirakawa, M. | | Deposit date: | 2010-12-16 | | Release date: | 2012-01-25 | | Last modified: | 2024-03-13 | | Method: | X-RAY DIFFRACTION (1.41 Å) | | Cite: | Recognition of modification status on a histone H3 tail by linked histone reader modules of the epigenetic regulator UHRF1
Proc.Natl.Acad.Sci.USA, 109, 2012
|
|
2KB9
 | |
1EDT
 | |
