7SQR
 
 | | 201phi2-1 Chimallin localized tetramer reconstruction | | Descriptor: | Chimallin | | Authors: | Laughlin, T.G, Deep, A, Prichard, A.M, Seitz, C, Gu, Y, Enustun, E, Suslov, S, Khanna, K, Birkholz, E.A, Amaro, R.E, Pogliano, J, Corbett, K.D, Villa, E. | | Deposit date: | 2021-11-06 | | Release date: | 2022-07-27 | | Last modified: | 2024-06-05 | | Method: | ELECTRON MICROSCOPY (3.4 Å) | | Cite: | Architecture and self-assembly of the jumbo bacteriophage nuclear shell.
Nature, 608, 2022
|
|
6TTB
 | | Crystal structure of NAD-dependent formate dehydrogenase from Staphylococcus aureus in complex with NAD | | Descriptor: | Formate dehydrogenase, NICOTINAMIDE-ADENINE-DINUCLEOTIDE | | Authors: | Boyko, K.M, Pometun, A.A, Nikolaeva, A.Y, Kargov, I.S, Yurchenko, T.S, Savin, S.S, Popov, V.O, Tishkov, V.I. | | Deposit date: | 2019-12-26 | | Release date: | 2021-01-13 | | Last modified: | 2024-01-24 | | Method: | X-RAY DIFFRACTION (2.7 Å) | | Cite: | Crystal structure of NAD-dependent formate dehydrogenase from Staphylococcus aureus in complex with NAD
To Be Published
|
|
4M05
 | | Crystal Structure of Mutant Chlorite Dismutase from Candidatus Nitrospira defluvii R173E | | Descriptor: | 1,2-ETHANEDIOL, ACETATE ION, Chlorite dismutase, ... | | Authors: | Gysel, K, Hagmueller, A, Djinovic-Carugo, K. | | Deposit date: | 2013-08-01 | | Release date: | 2014-01-15 | | Last modified: | 2024-02-28 | | Method: | X-RAY DIFFRACTION (2.28 Å) | | Cite: | Manipulating conserved heme cavity residues of chlorite dismutase: effect on structure, redox chemistry, and reactivity.
Biochemistry, 53, 2014
|
|
4XA4
 | | Crystal Structure of the coiled-coil surrounding Skip 3 of MYH7 | | Descriptor: | Xrcc4-MYH7(1551-1609) chimera protein | | Authors: | Taylor, K.C, Buvoli, M, Korkmaz, E.N, Buvoli, A, Zheng, Y, Heinz, N.T, Qiang, C, Leinwand, L.A, Rayment, I. | | Deposit date: | 2014-12-12 | | Release date: | 2015-07-01 | | Last modified: | 2023-09-27 | | Method: | X-RAY DIFFRACTION (2.327 Å) | | Cite: | Skip residues modulate the structural properties of the myosin rod and guide thick filament assembly.
Proc.Natl.Acad.Sci.USA, 112, 2015
|
|
5SI1
 | | CRYSTAL STRUCTURE OF HUMAN PHOSPHODIESTERASE 10 IN COMPLEX WITH C(=O)(N1CCOCC1)c5c(C(Nc3cc2nc(cn2cc3)c4ccccc4)=O)n(nc5)C, micromolar IC50=0.000072 | | Descriptor: | 1-methyl-4-(morpholine-4-carbonyl)-N-[(4R)-2-phenylimidazo[1,2-a]pyridin-7-yl]-1H-pyrazole-5-carboxamide, MAGNESIUM ION, ZINC ION, ... | | Authors: | Joseph, C, Benz, J, Flohr, A, Peters, J, Rudolph, M.G. | | Deposit date: | 2022-02-01 | | Release date: | 2022-10-12 | | Last modified: | 2024-10-16 | | Method: | X-RAY DIFFRACTION (1.75 Å) | | Cite: | Crystal Structure of a human phosphodiesterase 10 complex
To be published
|
|
7SQU
 | | Goslar chimallin C4 tetramer localized reconstruction | | Descriptor: | Chimallin | | Authors: | Laughlin, T.G, Deep, A, Prichard, A.M, Seitz, C, Gu, Y, Enustun, E, Suslov, S, Khanna, K, Birkholz, E.A, Amaro, R.E, Pogliano, J, Corbett, K.D, Villa, E. | | Deposit date: | 2021-11-06 | | Release date: | 2022-07-27 | | Last modified: | 2024-06-05 | | Method: | ELECTRON MICROSCOPY (2.6 Å) | | Cite: | Architecture and self-assembly of the jumbo bacteriophage nuclear shell.
Nature, 608, 2022
|
|
6AMS
 | |
6DIN
 | | High resolutionstructure of apo dTDP-4-dehydrorhamnose 3,5-epimerase | | Descriptor: | SULFATE ION, dTDP-4-dehydrorhamnose 3,5-epimerase | | Authors: | Chang, C, Jedrzejczak, R, Chhor, G, Joachimiak, A, Center for Structural Genomics of Infectious Diseases (CSGID) | | Deposit date: | 2018-05-23 | | Release date: | 2018-05-30 | | Method: | X-RAY DIFFRACTION (1.8 Å) | | Cite: | High resolutionstructure of apo dTDP-4-dehydrorhamnose 3,5-epimerase
To Be Published
|
|
2N30
 | | Structure of Ace-pvhct-NH2 | | Descriptor: | Hemocyanin subunit L2 | | Authors: | Petit, V.W, Rolland, J, Blond, A, Djediat, C, Peduzzi, J, Goulard, C, Bachere, E, Dupont, J, Destoumieux-Garzon, D, Rebuffat, S. | | Deposit date: | 2015-05-19 | | Release date: | 2015-06-17 | | Last modified: | 2016-01-27 | | Method: | SOLUTION NMR | | Cite: | A hemocyanin-derived antimicrobial peptide from the penaeid shrimp adopts an alpha-helical structure that specifically permeabilizes fungal membranes.
Biochim.Biophys.Acta, 1860, 2015
|
|
8T5E
 | | De novo design of high-affinity protein binders to bioactive helical peptides | | Descriptor: | Bcl-2-like protein 11, Bim_fulldiff | | Authors: | Torres, S.V, Leung, P.J.Y, Bera, A.K, Baker, D, Kang, A. | | Deposit date: | 2023-06-13 | | Release date: | 2024-01-10 | | Last modified: | 2024-02-14 | | Method: | X-RAY DIFFRACTION (3 Å) | | Cite: | De novo design of high-affinity binders of bioactive helical peptides.
Nature, 626, 2024
|
|
2NC6
 | | Solution Structure of N-L-idosylated Pin1 WW Domain | | Descriptor: | Pin1 WW Domain, beta-L-idopyranose | | Authors: | Hsu, C, Park, S, Mortenson, D.E, Foley, B, Wang, X, Woods, R.J, Case, D.A, Powers, E.T, Wong, C, Dyson, H, Kelly, J.W. | | Deposit date: | 2016-03-20 | | Release date: | 2016-06-08 | | Last modified: | 2023-06-14 | | Method: | SOLUTION NMR | | Cite: | The Dependence of Carbohydrate-Aromatic Interaction Strengths on the Structure of the Carbohydrate.
J.Am.Chem.Soc., 138, 2016
|
|
6TTU
 | | Ubiquitin Ligation to substrate by a cullin-RING E3 ligase at 3.7A resolution: NEDD8-CUL1-RBX1 N98R-SKP1-monomeric b-TRCP1dD-IkBa-UB~UBE2D2 | | Descriptor: | CYS-LYS-LYS-ALA-ARG-HIS-ASP-SEP-GLY, Cullin-1, E3 ubiquitin-protein ligase RBX1, ... | | Authors: | Baek, K, Prabu, J.R, Schulman, B.A. | | Deposit date: | 2019-12-30 | | Release date: | 2020-02-12 | | Last modified: | 2020-03-04 | | Method: | ELECTRON MICROSCOPY (3.7 Å) | | Cite: | NEDD8 nucleates a multivalent cullin-RING-UBE2D ubiquitin ligation assembly.
Nature, 578, 2020
|
|
7L5W
 | | p97-R155H mutant dodecamer I | | Descriptor: | Transitional endoplasmic reticulum ATPase | | Authors: | Nandi, P, Li, S, Coulmbres, R.C.A, Wang, F, Williams, D.R, Malyutin, A.G, Poh, Y.-P, Chou, T.-F, Chiu, P.-L. | | Deposit date: | 2020-12-23 | | Release date: | 2021-08-04 | | Last modified: | 2024-05-29 | | Method: | ELECTRON MICROSCOPY (3.34 Å) | | Cite: | Structural and Functional Analysis of Disease-Linked p97 ATPase Mutant Complexes.
Int J Mol Sci, 22, 2021
|
|
1U24
 | | Crystal structure of Selenomonas ruminantium phytase | | Descriptor: | myo-inositol hexaphosphate phosphohydrolase | | Authors: | Chu, H.M, Guo, R.T, Lin, T.W, Chou, C.C, Shr, H.L, Lai, H.L, Tang, T.Y, Cheng, K.J, Selinger, B.L, Wang, A.H.-J. | | Deposit date: | 2004-07-16 | | Release date: | 2004-11-09 | | Last modified: | 2024-10-16 | | Method: | X-RAY DIFFRACTION (2 Å) | | Cite: | Structures of Selenomonas ruminantium Phytase in Complex with Persulfated Phytate; DSP Phytase Fold and Mechanism for Sequential Substrate Hydrolysis
STRUCTURE, 12, 2004
|
|
5L92
 | |
2N9M
 | |
5SIX
 | | CRYSTAL STRUCTURE OF HUMAN PHOSPHODIESTERASE 10 IN COMPLEX WITH c1(cc(nc2cc(nn12)c3c(nc4c(n3)cccc4)C)N5CC[C@H](C5)F)NC6CCOCC6, micromolar IC50=0.007291 | | Descriptor: | (8S)-5-[(3S)-3-fluoropyrrolidin-1-yl]-2-(3-methylquinoxalin-2-yl)-N-(oxan-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine, MAGNESIUM ION, ZINC ION, ... | | Authors: | Joseph, C, Benz, J, Flohr, A, Gobbi, L, Rudolph, M.G. | | Deposit date: | 2022-02-01 | | Release date: | 2022-10-12 | | Last modified: | 2024-10-16 | | Method: | X-RAY DIFFRACTION (2.29 Å) | | Cite: | Crystal Structure of a human phosphodiesterase 10 complex
To be published
|
|
2N9P
 | | Solution structure of RNF126 N-terminal zinc finger domain in complex with BAG6 Ubiquitin-like domain | | Descriptor: | E3 ubiquitin-protein ligase RNF126, Large proline-rich protein BAG6, ZINC ION | | Authors: | Martinez-Lumbreras, S, Krysztofinska, E.M, Thapaliya, A, Isaacson, R.L. | | Deposit date: | 2015-12-01 | | Release date: | 2016-05-25 | | Last modified: | 2024-05-15 | | Method: | SOLUTION NMR | | Cite: | Structural and functional insights into the E3 ligase, RNF126.
Sci Rep, 6, 2016
|
|
7SQS
 | | 201phi2-1 Chimallin C1 localized reconstruction | | Descriptor: | Chimallin | | Authors: | Laughlin, T.G, Deep, A, Prichard, A.M, Seitz, C, Gu, Y, Enustun, E, Suslov, S, Khanna, K, Birkholz, E.A, Amaro, R.E, Pogliano, J, Corbett, K.D, Villa, E. | | Deposit date: | 2021-11-06 | | Release date: | 2022-07-27 | | Last modified: | 2024-06-05 | | Method: | ELECTRON MICROSCOPY (3.1 Å) | | Cite: | Architecture and self-assembly of the jumbo bacteriophage nuclear shell.
Nature, 608, 2022
|
|
5IB2
 | | Crystal structure of HLA-B*27:05 complexed with the self-peptide pVIPR | | Descriptor: | Beta-2-microglobulin, GLYCEROL, HLA class I histocompatibility antigen, ... | | Authors: | Janke, R, Ballaschk, M, Schmieder, P, Uchanska-Ziegler, B, Ziegler, A, Loll, B. | | Deposit date: | 2016-02-22 | | Release date: | 2017-02-01 | | Last modified: | 2024-10-09 | | Method: | X-RAY DIFFRACTION (1.44 Å) | | Cite: | Metal-triggered conformational reorientation of a self-peptide bound to a disease-associated HLA-B*27 subtype.
J.Biol.Chem., 2019
|
|
7SQV
 | | Goslar chimallin C1 localized reconstruction | | Descriptor: | Chimallin | | Authors: | Laughlin, T.G, Deep, A, Prichard, A.M, Seitz, C, Gu, Y, Enustun, E, Suslov, S, Khanna, K, Birkholz, E.A, Amaro, R.E, Pogliano, J, Corbett, K.D, Villa, E. | | Deposit date: | 2021-11-06 | | Release date: | 2022-07-27 | | Last modified: | 2024-06-05 | | Method: | ELECTRON MICROSCOPY (2.3 Å) | | Cite: | Architecture and self-assembly of the jumbo bacteriophage nuclear shell.
Nature, 608, 2022
|
|
4P7V
 | | Structural insights into higher-order assembly and function of the bacterial microcompartment protein PduA | | Descriptor: | GLYCEROL, Polyhedral bodies | | Authors: | Pang, A, Frank, S, Brown, I.R, Warren, M.J, Pickersgill, R.W. | | Deposit date: | 2014-03-27 | | Release date: | 2014-06-04 | | Last modified: | 2023-12-27 | | Method: | X-RAY DIFFRACTION (1.93 Å) | | Cite: | Structural Insights into Higher Order Assembly and Function of the Bacterial Microcompartment Protein PduA.
J.Biol.Chem., 289, 2014
|
|
6RCB
 | |
7SQT
 | | Goslar chimallin cubic (O, 24mer) assembly | | Descriptor: | Chimallin | | Authors: | Laughlin, T.G, Deep, A, Prichard, A.M, Seitz, C, Gu, Y, Enustun, E, Suslov, S, Khanna, K, Birkholz, E.A, Amaro, R.E, Pogliano, J, Corbett, K.D, Villa, E. | | Deposit date: | 2021-11-06 | | Release date: | 2022-07-27 | | Last modified: | 2024-06-05 | | Method: | ELECTRON MICROSCOPY (4 Å) | | Cite: | Architecture and self-assembly of the jumbo bacteriophage nuclear shell.
Nature, 608, 2022
|
|
1ZAF
 | | Crystal structure of estrogen receptor beta complexed with 3-Bromo-6-hydroxy-2-(4-hydroxy-phenyl)-inden-1-one | | Descriptor: | 3-BROMO-6-HYDROXY-2-(4-HYDROXYPHENYL)-1H-INDEN-1-ONE, Estrogen receptor beta, Nuclear receptor coactivator 1 | | Authors: | McDevitt, R.E, Malamas, M.S, Manas, E.S, Unwalla, R.J, Xu, Z.B, Miller, C.P, Harris, H.A. | | Deposit date: | 2005-04-06 | | Release date: | 2006-04-11 | | Last modified: | 2024-02-14 | | Method: | X-RAY DIFFRACTION (2.2 Å) | | Cite: | Estrogen receptor ligands: design and synthesis of new 2-arylindene-1-ones
Bioorg.Med.Chem.Lett., 15, 2005
|
|
