5EDG
CRYSTAL STRUCTURE OF HUMAN PHOSPHODIESTERASE 10 IN COMPLEX WITH c1(c(nc([nH]1)Cl)c2ccccc2)C4=NN(c3cccc(c3)OC(F)(F)F)C=CC4=O, micromolar IC50=0.029618
Entity
Entity ID | Chain ID | Description | Type | Chain length | Formula weight | Number of molecules | DB Name (Accession) | Biological source | Descriptive keywords |
1 | A, C, D (A, C, D) | cAMP and cAMP-inhibited cGMP 3',5'-cyclic phosphodiesterase 10A | polymer | 315 | 36529.1 | 3 | UniProt (Q9Y233) | Homo sapiens (Human) | |
2 | B (B) | cAMP and cAMP-inhibited cGMP 3',5'-cyclic phosphodiesterase 10A | polymer | 316 | 36600.2 | 1 | UniProt (Q9Y233) | Homo sapiens (Human) | |
3 | E, H, K, N (A, B, C, D) | ZINC ION | non-polymer | 65.4 | 4 | Chemie (ZN) | |||
4 | F, I, L, O (A, B, C, D) | MAGNESIUM ION | non-polymer | 24.3 | 4 | Chemie (MG) | |||
5 | G, J, M, P (A, B, C, D) | 3-(2-chloranyl-5-phenyl-1~{H}-imidazol-4-yl)-1-[3-(trifluoromethyloxy)phenyl]pyridazin-4-one | non-polymer | 432.8 | 4 | Chemie (5MG) | |||
6 | Q, R, S, T (A, B, C, D) | water | water | 18.0 | 319 | Chemie (HOH) |
Sequence modifications
A, C, D: 457 - 770 (UniProt: Q9Y233)
B: 457 - 770 (UniProt: Q9Y233)
PDB | External Database | Details |
---|---|---|
Ala 456 | - | expression tag |
Arg 470 | Lys 460 | conflict |
PDB | External Database | Details |
---|---|---|
Ala 456 | - | expression tag |
Arg 470 | Lys 460 | conflict |
Ala 771 | - | expression tag |
Sequence viewer
Contents of the asymmetric unit
Polymers | Number of chains | 4 |
Total formula weight | 146187.6 | |
Non-Polymers* | Number of molecules | 12 |
Total formula weight | 2090.0 | |
All* | Total formula weight | 148277.6 |