7FZO
Crystal Structure of human FABP4 in complex with 4-oxo-3-(2-phenylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylic acid, i.e. SMILES [C@H]12[C@@]3(O[C@H]([C@H]2C(=O)O)C=C3)CN(C1=O)CCc1ccccc1 with IC50=3.5 microM
Entity
| Entity ID | Chain ID | Description | Type | Chain length | Formula weight | Number of molecules | DB Name (Accession) | Biological source | Descriptive keywords |
| 1 | A (A) | Fatty acid-binding protein, adipocyte | polymer | 135 | 15022.2 | 1 | UniProt (P15090) Pfam (PF00061) | Homo sapiens (human) | Adipocyte lipid-binding protein,ALBP,Adipocyte-type fatty acid-binding protein,A-FABP,AFABP,Fatty acid-binding protein 4 |
| 2 | B (A) | (3aR,6S,7R,7aS)-1-oxo-2-(2-phenylethyl)-1,2,3,6,7,7a-hexahydro-3a,6-epoxyisoindole-7-carboxylic acid | non-polymer | 299.3 | 1 | Chemie (WH3) PubChem (16397982) PubChem (18389321) PubChem (19564478) PubChem (23306647) PubChem (23308595) PubChem (23308597) PubChem (23309590) PubChem (23309592) PubChem (42649230) PubChem (87048622) PubChem (754352) PubChem (1200988) PubChem (90476104) PubChem (91654021) PubChem (304675) PubChem (98142808) PubChem (102078159) PubChem (906395) PubChem (906396) PubChem (906397) PubChem (6347633) PubChem (6542531) PubChem (6560434) PubChem (169543786) | |||
| 3 | C (A) | FORMIC ACID | non-polymer | 46.0 | 1 | Chemie (FMT) PubChem (284) | |||
| 4 | D (A) | water | water | 18.0 | 209 | Chemie (HOH) |
Sequence modifications
A: 0 - 131 (UniProt: P15090)
| PDB | External Database | Details |
|---|---|---|
| Gly -3 | - | expression tag |
| Ser -2 | - | expression tag |
| His -1 | - | expression tag |
Sequence viewer
Contents of the asymmetric unit
| Polymers | Number of chains | 1 |
| Total formula weight | 15022.2 | |
| Non-Polymers* | Number of molecules | 2 |
| Total formula weight | 345.3 | |
| All* | Total formula weight | 15367.5 |
