7FYD
Crystal Structure of human FABP5 in complex with 6-chloro-4-phenyl-2-propan-2-ylquinoline-3-carboxylic acid, i.e. SMILES c1(ccc2c(c1)c(c1ccccc1)c(c(n2)C(C)C)C(=O)O)Cl with IC50=2.6 microM
Entity
Entity ID | Chain ID | Description | Type | Chain length | Formula weight | Number of molecules | DB Name (Accession) | Biological source | Descriptive keywords |
1 | A (A) | Fatty acid-binding protein 5 | polymer | 138 | 15467.7 | 1 | UniProt (Q01469) Pfam (PF00061) | Homo sapiens (human) | Epidermal-type fatty acid-binding protein,E-FABP,Fatty acid-binding protein,epidermal,Psoriasis-associated fatty acid-binding protein homolog,PA-FABP |
2 | B (A) | DIMETHYL SULFOXIDE | non-polymer | 78.1 | 1 | Chemie (DMS) | |||
3 | C, D (A) | SULFATE ION | non-polymer | 96.1 | 2 | Chemie (SO4) | |||
4 | E (A) | 6-chloro-4-phenyl-2-(propan-2-yl)quinoline-3-carboxylic acid | non-polymer | 325.8 | 1 | Chemie (VLQ) | |||
5 | F (A) | water | water | 18.0 | 93 | Chemie (HOH) |
Sequence modifications
A: 1 - 135 (UniProt: Q01469)
PDB | External Database | Details |
---|---|---|
Gly -2 | - | expression tag |
Ser -1 | - | expression tag |
His 0 | - | expression tag |
Sequence viewer
Contents of the asymmetric unit
Polymers | Number of chains | 1 |
Total formula weight | 15467.7 | |
Non-Polymers* | Number of molecules | 4 |
Total formula weight | 596.0 | |
All* | Total formula weight | 16063.8 |