7FXD
Crystal Structure of human FABP5 in complex with 2-(indole-1-carbonylamino)benzoic acid, i.e. SMILES c12N(C(=O)Nc3c(cccc3)C(=O)O)C=Cc1cccc2 with IC50=18.1696 microM
Entity
Entity ID | Chain ID | Description | Type | Chain length | Formula weight | Number of molecules | DB Name (Accession) | Biological source | Descriptive keywords |
1 | A (A) | Fatty acid-binding protein 5 | polymer | 138 | 15467.7 | 1 | UniProt (Q01469) Pfam (PF00061) | Homo sapiens (human) | Epidermal-type fatty acid-binding protein,E-FABP,Fatty acid-binding protein,epidermal,Psoriasis-associated fatty acid-binding protein homolog,PA-FABP |
2 | B (A) | 2-[(2,3-dihydro-1H-indole-1-carbonyl)amino]benzoic acid | non-polymer | 282.3 | 1 | Chemie (NC0) | |||
3 | C (A) | water | water | 18.0 | 19 | Chemie (HOH) |
Sequence modifications
A: 1 - 135 (UniProt: Q01469)
PDB | External Database | Details |
---|---|---|
Gly -2 | - | expression tag |
Ser -1 | - | expression tag |
His 0 | - | expression tag |
Sequence viewer
Contents of the asymmetric unit
Polymers | Number of chains | 1 |
Total formula weight | 15467.7 | |
Non-Polymers* | Number of molecules | 1 |
Total formula weight | 282.3 | |
All* | Total formula weight | 15750.0 |