7FXD
Crystal Structure of human FABP5 in complex with 2-(indole-1-carbonylamino)benzoic acid, i.e. SMILES c12N(C(=O)Nc3c(cccc3)C(=O)O)C=Cc1cccc2 with IC50=18.1696 microM
Functional Information from GO Data
| Chain | GOid | namespace | contents |
| A | 0001972 | molecular_function | retinoic acid binding |
| A | 0005319 | molecular_function | lipid carrier activity |
| A | 0005324 | molecular_function | long-chain fatty acid transmembrane transporter activity |
| A | 0005504 | molecular_function | fatty acid binding |
| A | 0005515 | molecular_function | protein binding |
| A | 0005576 | cellular_component | extracellular region |
| A | 0005634 | cellular_component | nucleus |
| A | 0005654 | cellular_component | nucleoplasm |
| A | 0005737 | cellular_component | cytoplasm |
| A | 0005829 | cellular_component | cytosol |
| A | 0005886 | cellular_component | plasma membrane |
| A | 0006629 | biological_process | lipid metabolic process |
| A | 0008289 | molecular_function | lipid binding |
| A | 0008544 | biological_process | epidermis development |
| A | 0014069 | cellular_component | postsynaptic density |
| A | 0015908 | biological_process | fatty acid transport |
| A | 0015909 | biological_process | long-chain fatty acid transport |
| A | 0019433 | biological_process | triglyceride catabolic process |
| A | 0030667 | cellular_component | secretory granule membrane |
| A | 0031392 | biological_process | regulation of prostaglandin biosynthetic process |
| A | 0035360 | biological_process | positive regulation of peroxisome proliferator activated receptor signaling pathway |
| A | 0035578 | cellular_component | azurophil granule lumen |
| A | 0042802 | molecular_function | identical protein binding |
| A | 0045202 | cellular_component | synapse |
| A | 0051930 | biological_process | regulation of sensory perception of pain |
| A | 0070062 | cellular_component | extracellular exosome |
| A | 0098921 | biological_process | retrograde trans-synaptic signaling by endocannabinoid |
| A | 0098978 | cellular_component | glutamatergic synapse |
| A | 0099092 | cellular_component | postsynaptic density, intracellular component |
| A | 0099178 | biological_process | regulation of retrograde trans-synaptic signaling by endocanabinoid |
| A | 0099524 | cellular_component | postsynaptic cytosol |
| A | 0120162 | biological_process | positive regulation of cold-induced thermogenesis |
| A | 1990379 | biological_process | lipid transport across blood-brain barrier |
Functional Information from PROSITE/UniProt
| site_id | PS00214 |
| Number of Residues | 18 |
| Details | FABP Cytosolic fatty-acid binding proteins signature. GRWrLvdSkGFDeYMKEL |
| Chain | Residue | Details |
| A | GLY9-LEU26 |
Functional Information from SwissProt/UniProt
| site_id | SWS_FT_FI1 |
| Number of Residues | 10 |
| Details | Motif: {"description":"Nuclear localization signal","evidences":[{"source":"PubMed","id":"24692551","evidenceCode":"ECO:0000269"}]} |
| Chain | Residue | Details |
| site_id | SWS_FT_FI2 |
| Number of Residues | 3 |
| Details | Binding site: {"evidences":[{"source":"PubMed","id":"24531463","evidenceCode":"ECO:0000269"},{"source":"PDB","id":"4AZR","evidenceCode":"ECO:0007744"}]} |
| Chain | Residue | Details |
| site_id | SWS_FT_FI3 |
| Number of Residues | 2 |
| Details | Binding site: {"evidences":[{"source":"PubMed","id":"24692551","evidenceCode":"ECO:0000269"},{"source":"PDB","id":"4LKT","evidenceCode":"ECO:0007744"}]} |
| Chain | Residue | Details |
| site_id | SWS_FT_FI4 |
| Number of Residues | 1 |
| Details | Modified residue: {"description":"N-acetylalanine","evidences":[{"source":"PubMed","id":"12665801","evidenceCode":"ECO:0000269"},{"source":"PubMed","id":"19413330","evidenceCode":"ECO:0007744"},{"source":"PubMed","id":"22223895","evidenceCode":"ECO:0007744"},{"source":"PubMed","id":"22814378","evidenceCode":"ECO:0007744"},{"source":"PubMed","id":"25944712","evidenceCode":"ECO:0007744"}]} |
| Chain | Residue | Details |
| site_id | SWS_FT_FI5 |
| Number of Residues | 1 |
| Details | Modified residue: {"description":"N6-acetyllysine","evidences":[{"source":"PubMed","id":"19608861","evidenceCode":"ECO:0007744"}]} |
| Chain | Residue | Details |
| site_id | SWS_FT_FI6 |
| Number of Residues | 1 |
| Details | Modified residue: {"description":"Phosphotyrosine","evidences":[{"source":"PubMed","id":"15592455","evidenceCode":"ECO:0007744"}]} |
| Chain | Residue | Details |






