7FWI
Crystal Structure of human FABP5 in complex with 2-(indole-1-carbonylamino)benzoic acid, i.e. SMILES c12N(C(=O)Nc3c(cccc3)C(=O)O)C=Cc1cccc2 with IC50=18.1696 microM
Entity
| Entity ID | Chain ID | Description | Type | Chain length | Formula weight | Number of molecules | DB Name (Accession) | Biological source | Descriptive keywords |
| 1 | A, B, C (A, B, C) | Fatty acid-binding protein 5 | polymer | 138 | 15467.7 | 3 | UniProt (Q01469) Pfam (PF00061) | Homo sapiens (human) | Epidermal-type fatty acid-binding protein,E-FABP,Fatty acid-binding protein,epidermal,Psoriasis-associated fatty acid-binding protein homolog,PA-FABP |
| 2 | D, G (A, C) | 2-[(2,3-dihydro-1H-indole-1-carbonyl)amino]benzoic acid | non-polymer | 282.3 | 2 | Chemie (NC0) | |||
| 3 | E, F, H (A, B, C) | CHLORIDE ION | non-polymer | 35.5 | 3 | Chemie (CL) | |||
| 4 | I, J, K (A, B, C) | water | water | 18.0 | 46 | Chemie (HOH) |
Sequence modifications
A, B, C: 1 - 135 (UniProt: Q01469)
| PDB | External Database | Details |
|---|---|---|
| Gly -2 | - | expression tag |
| Ser -1 | - | expression tag |
| His 0 | - | expression tag |
Sequence viewer
Contents of the asymmetric unit
| Polymers | Number of chains | 3 |
| Total formula weight | 46403.2 | |
| Non-Polymers* | Number of molecules | 5 |
| Total formula weight | 670.9 | |
| All* | Total formula weight | 47074.1 |






