5SKD
CRYSTAL STRUCTURE OF HUMAN PHOSPHODIESTERASE 10 IN COMPLEX WITH C1=CN(N=C(C1=O)c2ccnn2c3cc(ccc3F)F)c4cc(ccc4)OC(F)(F)F, micromolar IC50=0.047063
Entity
| Entity ID | Chain ID | Description | Type | Chain length | Formula weight | Number of molecules | DB Name (Accession) | Biological source | Descriptive keywords |
| 1 | A, B, C, D (A, B, C, D) | cAMP and cAMP-inhibited cGMP 3',5'-cyclic phosphodiesterase 10A | polymer | 343 | 39413.2 | 4 | UniProt (Q9Y233) Pfam (PF00233) | Homo sapiens (human) | |
| 2 | E, H, Q, W (A, B, C, D) | ZINC ION | non-polymer | 65.4 | 4 | Chemie (ZN) PubChem (32051) | |||
| 3 | F, I, R, X (A, B, C, D) | MAGNESIUM ION | non-polymer | 24.3 | 4 | Chemie (MG) PubChem (888) | |||
| 4 | G, P, V, Y (A, B, C, D) | 3-[1-(2,5-difluorophenyl)-1H-pyrazol-5-yl]-1-[3-(trifluoromethoxy)phenyl]pyridazin-4(1H)-one | non-polymer | 434.3 | 4 | Chemie (KER) PubChem (59369999) | |||
| 5 | J, K, L, M, N... (B, C) | PRASEODYMIUM ION | non-polymer | 140.9 | 8 | Chemie (PR) PubChem (185491) | |||
| 6 | O (B) | GLYCEROL | non-polymer | 92.1 | 1 | Chemie (GOL) PubChem (753) | |||
| 7 | AA, BA, CA, Z (B, C, D, A) | water | water | 18.0 | 511 | Chemie (HOH) |
Sequence modifications
A, B, C, D: 449 - 789 (UniProt: Q9Y233)
| PDB | External Database | Details |
|---|---|---|
| Gly 447 | - | expression tag |
| Ser 448 | - | expression tag |
Sequence viewer
Contents of the asymmetric unit
| Polymers | Number of chains | 4 |
| Total formula weight | 157652.8 | |
| Non-Polymers* | Number of molecules | 21 |
| Total formula weight | 3315.5 | |
| All* | Total formula weight | 160968.3 |






