MLW

?

Summary

Name:4-chloranyl-5~{H}-cyclohepta[b]indol-10-one
Formula:C13 H8 Cl N O
Formal charge:0
Molecular weight:229.662 Da
Component type:non-polymer

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.74-chloranyl-5~{H}-cyclohepta[b]indol-10-one

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C13H8ClNO/c14-9-5-3-4-8-12-10(15-13(8)9)6-1-2-7-11(12)16/h1-7,15H
InChIKeyInChI1.03BBOUTVQTMMUARP-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385Clc1cccc2c1[nH]c3C=CC=CC(=O)c23
SMILESCACTVS3.385Clc1cccc2c1[nH]c3C=CC=CC(=O)c23
SMILES_CANONICALOpenEye OEToolkits2.0.7c1cc2c3c([nH]c2c(c1)Cl)C=CC=CC3=O
SMILESOpenEye OEToolkits2.0.7c1cc2c3c([nH]c2c(c1)Cl)C=CC=CC3=O