L1M

?

Summary

Name:ethyl (R)-N-[(1E)-1-(diethylamino)ethylidene]phosphonamidate
Formula:C8 H19 N2 O2 P
Formal charge:0
Molecular weight:206.222 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.01ethyl (R)-N-[(1E)-1-(diethylamino)ethylidene]phosphonamidate
OpenEye OEToolkits2.0.7~{N}'-ethoxyphosphonoyl-~{N},~{N}-diethyl-ethanimidamide

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01C(C)N(/C(C)=N/P(OCC)=O)CC
InChIInChI1.03InChI=1S/C8H19N2O2P/c1-5-10(6-2)8(4)9-13(11)12-7-3/h13H,5-7H2,1-4H3/b9-8+
InChIKeyInChI1.03OJNAFPOCQGTUIK-CMDGGOBGSA-N
SMILES_CANONICALCACTVS3.385CCO[P@@H](=O)N=C(C)N(CC)CC
SMILESCACTVS3.385CCO[PH](=O)N=C(C)N(CC)CC
SMILES_CANONICALOpenEye OEToolkits2.0.7CCN(CC)/C(=N/[P@H](=O)OCC)/C
SMILESOpenEye OEToolkits2.0.7CCN(CC)C(=NP(=O)OCC)C