J58

?

Summary

Name:3-bromanyl-2~{H}-indazol-5-amine
Formula:C7 H6 Br N3
Formal charge:0
Molecular weight:212.047 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.63-bromanyl-2~{H}-indazol-5-amine

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C7H6BrN3/c8-7-5-3-4(9)1-2-6(5)10-11-7/h1-3H,9H2,(H,10,11)
InChIKeyInChI1.03AOKHRTSXJINPPJ-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385Nc1ccc2n[nH]c(Br)c2c1
SMILESCACTVS3.385Nc1ccc2n[nH]c(Br)c2c1
SMILES_CANONICALOpenEye OEToolkits2.0.6c1cc2c(cc1N)c([nH]n2)Br
SMILESOpenEye OEToolkits2.0.6c1cc2c(cc1N)c([nH]n2)Br