FUX

?

Summary

Name:5-HYDROXYMETHYL-FURFURAL
Formula:C6 H6 O3
Formal charge:0
Molecular weight:126.11 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.045-(hydroxymethyl)furan-2-carbaldehyde
OpenEye OEToolkits1.5.05-(hydroxymethyl)furan-2-carbaldehyde

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=Cc1oc(cc1)CO
SMILES_CANONICALCACTVS3.341OCc1oc(C=O)cc1
SMILESCACTVS3.341OCc1oc(C=O)cc1
SMILES_CANONICALOpenEye OEToolkits1.5.0c1cc(oc1CO)C=O
SMILESOpenEye OEToolkits1.5.0c1cc(oc1CO)C=O
InChIInChI1.03InChI=1S/C6H6O3/c7-3-5-1-2-6(4-8)9-5/h1-3,8H,4H2
InChIKeyInChI1.03NOEGNKMFWQHSLB-UHFFFAOYSA-N