FPL

?

Summary

Name:5-fluoro-2-phenoxyphenol
Formula:C12 H9 F O2
Formal charge:0
Molecular weight:204.197 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.015-fluoro-2-phenoxyphenol
OpenEye OEToolkits1.7.65-fluoranyl-2-phenoxy-phenol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01Fc2ccc(Oc1ccccc1)c(O)c2
InChIInChI1.03InChI=1S/C12H9FO2/c13-9-6-7-12(11(14)8-9)15-10-4-2-1-3-5-10/h1-8,14H
InChIKeyInChI1.03DEMPPYSGPXLMNG-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.370Oc1cc(F)ccc1Oc2ccccc2
SMILESCACTVS3.370Oc1cc(F)ccc1Oc2ccccc2
SMILES_CANONICALOpenEye OEToolkits1.7.6c1ccc(cc1)Oc2ccc(cc2O)F
SMILESOpenEye OEToolkits1.7.6c1ccc(cc1)Oc2ccc(cc2O)F