FB4

?

Summary

Name:2-(2-amino-4-chlorophenoxy)-5-chlorophenol
Formula:C12 H9 Cl2 N O2
Formal charge:0
Molecular weight:270.111 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits1.6.12-(2-azanyl-4-chloro-phenoxy)-5-chloro-phenol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILES_CANONICALCACTVS3.352Nc1cc(Cl)ccc1Oc2ccc(Cl)cc2O
SMILESCACTVS3.352Nc1cc(Cl)ccc1Oc2ccc(Cl)cc2O
SMILES_CANONICALOpenEye OEToolkits1.7.0c1cc(c(cc1Cl)N)Oc2ccc(cc2O)Cl
SMILESOpenEye OEToolkits1.7.0c1cc(c(cc1Cl)N)Oc2ccc(cc2O)Cl
InChIInChI1.03InChI=1S/C12H9Cl2NO2/c13-7-1-3-11(9(15)5-7)17-12-4-2-8(14)6-10(12)16/h1-6,16H,15H2
InChIKeyInChI1.03ZNHVVJUATLQYST-UHFFFAOYSA-N
167518
PDB entries from 2020-08-12