F9Y

?

Summary

Name:1H-indole-6-carbonitrile
Formula:C9 H6 N2
Formal charge:0
Molecular weight:142.157 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.011H-indole-6-carbonitrile
OpenEye OEToolkits2.0.61~{H}-indole-6-carbonitrile

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01C(c2ccc1ccnc1c2)#N
InChIInChI1.03InChI=1S/C9H6N2/c10-6-7-1-2-8-3-4-11-9(8)5-7/h1-5,11H
InChIKeyInChI1.03SZSZDBFJCQKTRG-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385N#Cc1ccc2cc[nH]c2c1
SMILESCACTVS3.385N#Cc1ccc2cc[nH]c2c1
SMILES_CANONICALOpenEye OEToolkits2.0.6c1cc(cc2c1cc[nH]2)C#N
SMILESOpenEye OEToolkits2.0.6c1cc(cc2c1cc[nH]2)C#N