F7V

?

Summary

Name:(2S,4E)-2-aminohex-4-enoic acid
Formula:C6 H11 N O2
Formal charge:0
Molecular weight:129.157 Da
Component type:L-peptide linking

Chemical Identifiers

ProgramVersionName
ACDLabs12.01(2S,4E)-2-aminohex-4-enoic acid
OpenEye OEToolkits2.0.6(~{E},2~{S})-2-azanylhex-4-enoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01NC(C(O)=O)C\C=C\C
InChIInChI1.03InChI=1S/C6H11NO2/c1-2-3-4-5(7)6(8)9/h2-3,5H,4,7H2,1H3,(H,8,9)/b3-2+/t5-/m0/s1
InChIKeyInChI1.03OPOBBDXDRHKTJF-HRJJCQLASA-N
SMILES_CANONICALCACTVS3.385C/C=C/C[C@H](N)C(O)=O
SMILESCACTVS3.385CC=CC[CH](N)C(O)=O
SMILES_CANONICALOpenEye OEToolkits2.0.6C/C=C/C[C@@H](C(=O)O)N
SMILESOpenEye OEToolkits2.0.6CC=CCC(C(=O)O)N