EBF

?

Summary

Name:7-methoxychromen-2-one
Formula:C10 H8 O3
Formal charge:0
Molecular weight:176.169 Da
Component type:non-polymer

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.77-methoxychromen-2-one

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C10H8O3/c1-12-8-4-2-7-3-5-10(11)13-9(7)6-8/h2-6H,1H3
InChIKeyInChI1.03LIIALPBMIOVAHH-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385COc1ccc2C=CC(=O)Oc2c1
SMILESCACTVS3.385COc1ccc2C=CC(=O)Oc2c1
SMILES_CANONICALOpenEye OEToolkits2.0.7COc1ccc2c(c1)OC(=O)C=C2
SMILESOpenEye OEToolkits2.0.7COc1ccc2c(c1)OC(=O)C=C2