CP7

?

Summary

Name:6-ETHYL-5-PHENYLPYRIMIDINE-2,4-DIAMINE
Formula:C12 H14 N4
Formal charge:0
Molecular weight:214.266 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.046-ethyl-5-phenylpyrimidine-2,4-diamine
OpenEye OEToolkits1.5.06-ethyl-5-phenyl-pyrimidine-2,4-diamine

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04n1c(c(c(nc1N)N)c2ccccc2)CC
SMILES_CANONICALCACTVS3.341CCc1nc(N)nc(N)c1c2ccccc2
SMILESCACTVS3.341CCc1nc(N)nc(N)c1c2ccccc2
SMILES_CANONICALOpenEye OEToolkits1.5.0CCc1c(c(nc(n1)N)N)c2ccccc2
SMILESOpenEye OEToolkits1.5.0CCc1c(c(nc(n1)N)N)c2ccccc2
InChIInChI1.03InChI=1S/C12H14N4/c1-2-9-10(8-6-4-3-5-7-8)11(13)16-12(14)15-9/h3-7H,2H2,1H3,(H4,13,14,15,16)
InChIKeyInChI1.03XREDUPOVEQDQQS-UHFFFAOYSA-N
167518
PDB entries from 2020-08-12