C5X

?

Summary

Name:3-[(2R)-oxiran-2-yl]propyl beta-D-xylopyranoside
Synonyms:4,5-EPOXYPENTYL-BETA-D-XYLOSIDE
3-[(2R)-oxiran-2-yl]propyl beta-D-xyloside; 3-[(2R)-oxiran-2-yl]propyl D-xyloside; 3-[(2R)-oxiran-2-yl]propyl xyloside
Formula:C10 H18 O6
Formal charge:0
Molecular weight:234.246 Da
Component type:D-saccharide

Chemical Identifiers

ProgramVersionName
ACDLabs10.043-[(2R)-oxiran-2-yl]propyl beta-D-xylopyranoside
OpenEye OEToolkits1.5.0(2R,3R,4S,5R)-2-[3-[(2R)-oxiran-2-yl]propoxy]oxane-3,4,5-triol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O(CCCC1OC1)C2OCC(O)C(O)C2O
SMILES_CANONICALCACTVS3.341O[C@@H]1CO[C@@H](OCCC[C@@H]2CO2)[C@H](O)[C@H]1O
SMILESCACTVS3.341O[CH]1CO[CH](OCCC[CH]2CO2)[CH](O)[CH]1O
SMILES_CANONICALOpenEye OEToolkits1.5.0C1[C@H](O1)CCCO[C@H]2[C@@H]([C@H]([C@@H](CO2)O)O)O
SMILESOpenEye OEToolkits1.5.0C1C(O1)CCCOC2C(C(C(CO2)O)O)O
InChIInChI1.03InChI=1S/C10H18O6/c11-7-5-16-10(9(13)8(7)12)14-3-1-2-6-4-15-6/h6-13H,1-5H2/t6-,7-,8+,9-,10-/m1/s1
InChIKeyInChI1.03DMNHSULDBMDHLY-HOTMZDKISA-N
167518
PDB entries from 2020-08-12