C5B

?

Summary

Name:(1S,3R)-1-AMINOCYCLOPENTANE-1,3-DICARBOXYLIC ACID
Synonyms:1S,3R-ACPD
Formula:C7 H11 N O4
Formal charge:0
Molecular weight:173.167 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04(1S,3R)-1-aminocyclopentane-1,3-dicarboxylic acid
OpenEye OEToolkits1.5.0(1S,3R)-1-aminocyclopentane-1,3-dicarboxylic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(O)C1(N)CC(C(=O)O)CC1
SMILES_CANONICALCACTVS3.341N[C@]1(CC[C@H](C1)C(O)=O)C(O)=O
SMILESCACTVS3.341N[C]1(CC[CH](C1)C(O)=O)C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.5.0C1C[C@](C[C@@H]1C(=O)O)(C(=O)O)N
SMILESOpenEye OEToolkits1.5.0C1CC(CC1C(=O)O)(C(=O)O)N
InChIInChI1.03InChI=1S/C7H11NO4/c8-7(6(11)12)2-1-4(3-7)5(9)10/h4H,1-3,8H2,(H,9,10)(H,11,12)/t4-,7+/m1/s1
InChIKeyInChI1.03YFYNOWXBIBKGHB-FBCQKBJTSA-N
167132
PDB entries from 2020-07-29