C4F

?

Summary

Name:3-(3-methoxybenzyl)-1H-pyrrolo[2,3-b]pyridine
Formula:C15 H14 N2 O
Formal charge:0
Molecular weight:238.284 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.043-(3-methoxybenzyl)-1H-pyrrolo[2,3-b]pyridine
OpenEye OEToolkits1.5.03-[(3-methoxyphenyl)methyl]-1H-pyrrolo[2,3-b]pyridine

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04n1cccc2c1ncc2Cc3cccc(OC)c3
SMILES_CANONICALCACTVS3.341COc1cccc(Cc2c[nH]c3ncccc23)c1
SMILESCACTVS3.341COc1cccc(Cc2c[nH]c3ncccc23)c1
SMILES_CANONICALOpenEye OEToolkits1.5.0COc1cccc(c1)Cc2c[nH]c3c2cccn3
SMILESOpenEye OEToolkits1.5.0COc1cccc(c1)Cc2c[nH]c3c2cccn3
InChIInChI1.03InChI=1S/C15H14N2O/c1-18-13-5-2-4-11(9-13)8-12-10-17-15-14(12)6-3-7-16-15/h2-7,9-10H,8H2,1H3,(H,16,17)
InChIKeyInChI1.03GHQCCHWTDLTMJT-UHFFFAOYSA-N