7YO

?

Summary

Name:(2R)-5-oxidanylidenepyrrolidine-2-carboxylic acid
Formula:C5 H7 N O3
Formal charge:0
Molecular weight:129.114 Da
Component type:peptide linking

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.6(2~{R})-5-oxidanylidenepyrrolidine-2-carboxylic acid

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C5H7NO3/c7-4-2-1-3(6-4)5(8)9/h3H,1-2H2,(H,6,7)(H,8,9)/t3-/m1/s1
InChIKeyInChI1.03ODHCTXKNWHHXJC-GSVOUGTGSA-N
SMILES_CANONICALCACTVS3.385OC(=O)[C@H]1CCC(=O)N1
SMILESCACTVS3.385OC(=O)[CH]1CCC(=O)N1
SMILES_CANONICALOpenEye OEToolkits2.0.6C1CC(=O)N[C@H]1C(=O)O
SMILESOpenEye OEToolkits2.0.6C1CC(=O)NC1C(=O)O
168889
PDB entries from 2020-09-16