41Q

?

Summary

Name:4-imino-L-homoserine
Formula:C4 H8 N2 O3
Formal charge:0
Molecular weight:132.118 Da
Component type:L-PEPTIDE LINKING

Chemical Identifiers

ProgramVersionName
ACDLabs12.014-imino-L-homoserine
OpenEye OEToolkits1.7.6(2S)-2-azanyl-4-azanylidene-4-oxidanyl-butanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(O)C(N)CC(=[N@H])O
InChIInChI1.03InChI=1S/C4H8N2O3/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H2,6,7)(H,8,9)/t2-/m0/s1
InChIKeyInChI1.03DCXYFEDJOCDNAF-REOHCLBHSA-N
SMILES_CANONICALCACTVS3.385N[C@@H](CC(O)=N)C(O)=O
SMILESCACTVS3.385N[CH](CC(O)=N)C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.7.6[H]/N=C(/C[C@@H](C(=O)O)N)\O
SMILESOpenEye OEToolkits1.7.6C(C(C(=O)O)N)C(=N)O