0XM

?

Summary

Name:1,1-diphenylmethanamine
Formula:C13 H13 N
Formal charge:0
Molecular weight:183.249 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.011,1-diphenylmethanamine
OpenEye OEToolkits1.7.6diphenylmethanamine

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01c1(ccccc1)C(N)c2ccccc2
InChIInChI1.03InChI=1S/C13H13N/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H,14H2
InChIKeyInChI1.03MGHPNCMVUAKAIE-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.370NC(c1ccccc1)c2ccccc2
SMILESCACTVS3.370NC(c1ccccc1)c2ccccc2
SMILES_CANONICALOpenEye OEToolkits1.7.6c1ccc(cc1)C(c2ccccc2)N
SMILESOpenEye OEToolkits1.7.6c1ccc(cc1)C(c2ccccc2)N