0WS

?

Summary

Name:2-(1H-pyrazol-3-yl)pyridine-4-carboxylic acid
Formula:C9 H7 N3 O2
Formal charge:0
Molecular weight:189.171 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.012-(1H-pyrazol-3-yl)pyridine-4-carboxylic acid
OpenEye OEToolkits1.7.62-(1H-pyrazol-3-yl)pyridine-4-carboxylic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(O)c2ccnc(c1nncc1)c2
InChIInChI1.03InChI=1S/C9H7N3O2/c13-9(14)6-1-3-10-8(5-6)7-2-4-11-12-7/h1-5H,(H,11,12)(H,13,14)
InChIKeyInChI1.03NTNYOLXCVCDWFY-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.370OC(=O)c1ccnc(c1)c2cc[nH]n2
SMILESCACTVS3.370OC(=O)c1ccnc(c1)c2cc[nH]n2
SMILES_CANONICALOpenEye OEToolkits1.7.6c1c[nH]nc1c2cc(ccn2)C(=O)O
SMILESOpenEye OEToolkits1.7.6c1c[nH]nc1c2cc(ccn2)C(=O)O