0QA

?

Summary

Name:4-[methyl(nitroso)amino]-1-(pyridin-3-yl)butan-1-one
Formula:C10 H13 N3 O2
Formal charge:0
Molecular weight:207.229 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.014-[methyl(nitroso)amino]-1-(pyridin-3-yl)butan-1-one
OpenEye OEToolkits1.7.6N-methyl-N-(4-oxidanylidene-4-pyridin-3-yl-butyl)nitrous amide

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(c1cccnc1)CCCN(N=O)C
InChIInChI1.03InChI=1S/C10H13N3O2/c1-13(12-15)7-3-5-10(14)9-4-2-6-11-8-9/h2,4,6,8H,3,5,7H2,1H3
InChIKeyInChI1.03FLAQQSHRLBFIEZ-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.370CN(CCCC(=O)c1cccnc1)N=O
SMILESCACTVS3.370CN(CCCC(=O)c1cccnc1)N=O
SMILES_CANONICALOpenEye OEToolkits1.7.6CN(CCCC(=O)c1cccnc1)N=O
SMILESOpenEye OEToolkits1.7.6CN(CCCC(=O)c1cccnc1)N=O