0NX

?

Summary

Name:(5-phenyl-1,2-oxazol-3-yl)methanol
Formula:C10 H9 N O2
Formal charge:0
Molecular weight:175.184 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.01(5-phenyl-1,2-oxazol-3-yl)methanol
OpenEye OEToolkits1.7.6(5-phenyl-1,2-oxazol-3-yl)methanol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01OCc2noc(c1ccccc1)c2
InChIInChI1.03InChI=1S/C10H9NO2/c12-7-9-6-10(13-11-9)8-4-2-1-3-5-8/h1-6,12H,7H2
InChIKeyInChI1.03BPAFLGGUEBMWRN-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.370OCc1cc(on1)c2ccccc2
SMILESCACTVS3.370OCc1cc(on1)c2ccccc2
SMILES_CANONICALOpenEye OEToolkits1.7.6c1ccc(cc1)c2cc(no2)CO
SMILESOpenEye OEToolkits1.7.6c1ccc(cc1)c2cc(no2)CO
169117
PDB entries from 2020-09-23