0NP

?

Summary

Name:2',3'-dideoxy-2'-fluoro-3'-triaza-1,2-dien-2-ium-1-yluridine
Formula:C9 H11 F N5 O4
Formal charge:1
Molecular weight:272.213 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.012',3'-dideoxy-2'-fluoro-3'-triaza-1,2-dien-2-ium-1-yluridine
OpenEye OEToolkits1.7.6azanylidene-[(2S,3R,4R,5R)-5-[2,4-bis(oxidanylidene)pyrimidin-1-yl]-4-fluoranyl-2-(hydroxymethyl)oxolan-3-yl]imino-azanium

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C1NC(=O)N(C=C1)C2OC(C(\N=[N+]=[N@H])C2F)CO
InChIInChI1.03InChI=1S/C9H10FN5O4/c10-6-7(13-14-11)4(3-16)19-8(6)15-2-1-5(17)12-9(15)18/h1-2,4,6-8,11,16H,3H2/p+1/t4-,6-,7-,8-/m1/s1
InChIKeyInChI1.03YRIDFNZYEULFDH-XVFCMESISA-O
SMILES_CANONICALCACTVS3.370OC[C@H]1O[C@H]([C@H](F)[C@@H]1N=[N+]=N)N2C=CC(=O)NC2=O
SMILESCACTVS3.370OC[CH]1O[CH]([CH](F)[CH]1N=[N+]=N)N2C=CC(=O)NC2=O
SMILES_CANONICALOpenEye OEToolkits1.7.6C1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)N=[N+]=N)F
SMILESOpenEye OEToolkits1.7.6C1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)N=[N+]=N)F