0LO

?

Summary

Name:5-phenylpyridine-3-carboxylic acid
Formula:C12 H9 N O2
Formal charge:0
Molecular weight:199.205 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.015-phenylpyridine-3-carboxylic acid
OpenEye OEToolkits1.7.65-phenylpyridine-3-carboxylic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(O)c2cc(c1ccccc1)cnc2
InChIInChI1.03InChI=1S/C12H9NO2/c14-12(15)11-6-10(7-13-8-11)9-4-2-1-3-5-9/h1-8H,(H,14,15)
InChIKeyInChI1.03VKFXHYRIHRTEIV-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.370OC(=O)c1cncc(c1)c2ccccc2
SMILESCACTVS3.370OC(=O)c1cncc(c1)c2ccccc2
SMILES_CANONICALOpenEye OEToolkits1.7.6c1ccc(cc1)c2cc(cnc2)C(=O)O
SMILESOpenEye OEToolkits1.7.6c1ccc(cc1)c2cc(cnc2)C(=O)O