0LH

?

Summary

Name:2-(1H-indol-1-yl)ethanamine
Formula:C10 H12 N2
Formal charge:0
Molecular weight:160.216 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.012-(1H-indol-1-yl)ethanamine
OpenEye OEToolkits1.7.62-indol-1-ylethanamine

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01c1cccc2c1ccn2CCN
InChIInChI1.03InChI=1S/C10H12N2/c11-6-8-12-7-5-9-3-1-2-4-10(9)12/h1-5,7H,6,8,11H2
InChIKeyInChI1.03BXEFQUSYBZYTAE-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.370NCCn1ccc2ccccc12
SMILESCACTVS3.370NCCn1ccc2ccccc12
SMILES_CANONICALOpenEye OEToolkits1.7.6c1ccc2c(c1)ccn2CCN
SMILESOpenEye OEToolkits1.7.6c1ccc2c(c1)ccn2CCN
167518
PDB entries from 2020-08-12