007

?

Summary

Name:1-METHYLAMINE-1-BENZYL-CYCLOPENTANE
Synonyms:1-(1-PHENYLCYCLOPENTYL)METHANAMINE
Formula:C12 H17 N
Formal charge:0
Molecular weight:175.27 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.041-(1-phenylcyclopentyl)methanamine
OpenEye OEToolkits1.5.0(1-phenylcyclopentyl)methanamine

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04c1c(cccc1)C2(CN)CCCC2
SMILES_CANONICALCACTVS3.341NCC1(CCCC1)c2ccccc2
SMILESCACTVS3.341NCC1(CCCC1)c2ccccc2
SMILES_CANONICALOpenEye OEToolkits1.5.0c1ccc(cc1)C2(CCCC2)CN
SMILESOpenEye OEToolkits1.5.0c1ccc(cc1)C2(CCCC2)CN
InChIInChI1.03InChI=1S/C12H17N/c13-10-12(8-4-5-9-12)11-6-2-1-3-7-11/h1-3,6-7H,4-5,8-10,13H2
InChIKeyInChI1.03SJWOFBVBNFLWLP-UHFFFAOYSA-N
169117
PDB entries from 2020-09-23