PRD_002334
Summary
| Name: | Linear tetrapeptide related to pseudoxylallemycin A |
| Formula: | C32 H46 N4 O5 |
| Fomular weight: | 566.731 |
| Component type: | peptide-like |
| Polymer sequences: | MLE, PHE, MLE, DPN |
| Non-polymer components: | |
| BIRD class: | Antibiotic |
| Represented as: | polymer |
| Compound Details: | Mle-Phe-Mle-D-Phe. Linear tetrapeptide related to pseudoxylallemycin A. This peptide is linear, unlike cyclic pseudoxylallemycin A, and contains terminal D-Phe, unlike pseudoxylallemycin A that contains Phe. |
| Program | Version | Name |
| OpenEye OEToolkits | 2.0.7 | (2~{R})-2-[[(2~{S})-4-methyl-2-[methyl-[(2~{S})-2-[[(2~{S})-4-methyl-2-(methylamino)pentanoyl]amino]-3-phenyl-propanoyl]amino]pentanoyl]amino]-3-phenyl-propanoic acid |
Chemical Descriptors
| Type | Program | Version | Descriptor |
| SMILES_CANONICAL | CACTVS | 3.385 | CN[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N(C)[C@@H](CC(C)C)C(=O)N[C@H](Cc2ccccc2)C(O)=O |
| SMILES | CACTVS | 3.385 | CN[CH](CC(C)C)C(=O)N[CH](Cc1ccccc1)C(=O)N(C)[CH](CC(C)C)C(=O)N[CH](Cc2ccccc2)C(O)=O |
| SMILES_CANONICAL | OpenEye OEToolkits | 2.0.7 | CC(C)C[C@@H](C(=O)N[C@@H](Cc1ccccc1)C(=O)N(C)[C@@H](CC(C)C)C(=O)N[C@H](Cc2ccccc2)C(=O)O)NC |
| SMILES | OpenEye OEToolkits | 2.0.7 | CC(C)CC(C(=O)NC(Cc1ccccc1)C(=O)N(C)C(CC(C)C)C(=O)NC(Cc2ccccc2)C(=O)O)NC |
