2F1A
 
 | | GOLGI ALPHA-MANNOSIDASE II COMPLEX WITH (2R,3R,4S)-2-({[(1S)-2-hydroxy-1-phenylethyl]amino}methyl)pyrrolidine-3,4-diol | | Descriptor: | (2R,3R,4S)-2-({[(1S)-2-HYDROXY-1-PHENYLETHYL]AMINO}METHYL)PYRROLIDINE-3,4-DIOL, (4S)-2-METHYL-2,4-PENTANEDIOL, 2-acetamido-2-deoxy-beta-D-glucopyranose, ... | | Authors: | Kuntz, D.A, Rose, D.R. | | Deposit date: | 2005-11-14 | | Release date: | 2006-12-05 | | Last modified: | 2024-11-20 | | Method: | X-RAY DIFFRACTION (1.45 Å) | | Cite: | Evaluation of docking programs for predicting binding of Golgi alpha-mannosidase II inhibitors: a comparison with crystallography.
Proteins, 69, 2007
|
|
6K3Q
 | | Crystal Structure of P450BM3 with N-(3-cyclohexylpropanoyl)-L-prolyl-L-phenylalanine | | Descriptor: | (2S)-2-[[(2S)-1-(3-cyclohexylpropanoyl)pyrrolidin-2-yl]carbonylamino]-3-phenyl-propanoic acid, Bifunctional cytochrome P450/NADPH--P450 reductase, DIMETHYL SULFOXIDE, ... | | Authors: | Shoji, O, Yonemura, K. | | Deposit date: | 2019-05-21 | | Release date: | 2020-05-27 | | Last modified: | 2023-11-22 | | Method: | X-RAY DIFFRACTION (2.06 Å) | | Cite: | Systematic Evolution of Decoy Molecules for the Highly Efficient Hydroxylation of Benzene and Small Alkanes Catalyzed by Wild-Type Cytochrome P450BM3
Acs Catalysis, 10, 2020
|
|
2UXY
 | | Aliphatic amidase | | Descriptor: | ALIPHATIC AMIDASE, SULFATE ION | | Authors: | Andrade, J, KArmali, A, Carrondo, M.A, Frazao, C. | | Deposit date: | 2007-04-02 | | Release date: | 2007-04-17 | | Last modified: | 2025-04-09 | | Method: | X-RAY DIFFRACTION (1.25 Å) | | Cite: | Structure of Amidase from Pseudomonas Aeruginosa Showing a Trapped Acyl Transfer Reaction Intermediate State.
J.Biol.Chem., 282, 2007
|
|
4BMS
 | | Short chain alcohol dehydrogenase from Ralstonia sp. DSM 6428 in complex with NADPH | | Descriptor: | ALCLOHOL DEHYDROGENASE/SHORT-CHAIN DEHYDROGENASE, NADP NICOTINAMIDE-ADENINE-DINUCLEOTIDE PHOSPHATE | | Authors: | Man, H, Kulig, J, Rother, D, Grogan, G. | | Deposit date: | 2013-05-10 | | Release date: | 2014-03-19 | | Last modified: | 2024-05-08 | | Method: | X-RAY DIFFRACTION (2.89 Å) | | Cite: | Structures of Alcohol Dehydrogenases from Ralstonia and Sphingobium Spp. Reveal the Molecular Basis for Their Recognition of 'Bulky-Bulky' Ketones
Top.Catal., 57, 2014
|
|
6K55
 | | Inactivated mutant (D140A) of Hyperthermophilic GH6 cellobiohydrolase II (HmCel6A) in complex with hexasaccharide | | Descriptor: | Glucanase, MAGNESIUM ION, beta-D-glucopyranose-(1-4)-beta-D-glucopyranose-(1-4)-beta-D-glucopyranose-(1-4)-beta-D-glucopyranose-(1-4)-beta-D-glucopyranose-(1-4)-beta-D-glucopyranose-(1-4)-beta-D-glucopyranose | | Authors: | Baba, S, Takeda, M, Okuma, J, Hirose, Y, Nishimura, A, Takata, M, Oda, K, Shibata, D, Kondo, Y, Kumasaka, T. | | Deposit date: | 2019-05-28 | | Release date: | 2020-06-03 | | Last modified: | 2024-10-23 | | Method: | X-RAY DIFFRACTION (2.883 Å) | | Cite: | A hyperthermophilic cellobiohydrolase mined from a hot spring metagenomic data
To Be Published
|
|
4PZ2
 | | Structure of Zm ALDH2-6 (RF2F) in complex with NAD | | Descriptor: | 1,2-ETHANEDIOL, DI(HYDROXYETHYL)ETHER, NICOTINAMIDE-ADENINE-DINUCLEOTIDE, ... | | Authors: | Morera, S, Vigouroux, A, Kopecny, D. | | Deposit date: | 2014-03-28 | | Release date: | 2015-03-18 | | Last modified: | 2023-09-20 | | Method: | X-RAY DIFFRACTION (2.4 Å) | | Cite: | Role and structural characterization of plant aldehyde dehydrogenases from family 2 and family 7.
Biochem.J., 468, 2015
|
|
6K5L
 | | The crystal structure of isocitrate dehydrogenase kinase/phosphatase wtih two Mn2+ from E. coli | | Descriptor: | ADENOSINE MONOPHOSPHATE, ADENOSINE-5'-DIPHOSPHATE, Isocitrate dehydrogenase kinase/phosphatase, ... | | Authors: | Zhang, X, Lei, Z, Zheng, J, Jia, Z. | | Deposit date: | 2019-05-29 | | Release date: | 2019-07-03 | | Last modified: | 2023-11-22 | | Method: | X-RAY DIFFRACTION (2.55 Å) | | Cite: | Characterization of metal binding of bifunctional kinase/phosphatase AceK and implication in activity modulation.
Sci Rep, 9, 2019
|
|
3GNC
 | |
3EF6
 | | Crystal structure of Toluene 2,3-Dioxygenase Reductase | | Descriptor: | FLAVIN-ADENINE DINUCLEOTIDE, GLYCEROL, SULFATE ION, ... | | Authors: | Friemann, R, Lee, K, Brown, E.N, Gibson, D.T, Eklund, H, Ramaswamy, S. | | Deposit date: | 2008-09-08 | | Release date: | 2009-03-10 | | Last modified: | 2023-08-30 | | Method: | X-RAY DIFFRACTION (1.8 Å) | | Cite: | Structures of the multicomponent Rieske non-heme iron toluene 2,3-dioxygenase enzyme system
Acta Crystallogr.,Sect.D, 65, 2009
|
|
2VNV
 | | Crystal structure of BclA lectin from burkholderia cenocepacia in complex with alpha-methyl-mannoside at 1.7 Angstrom resolution | | Descriptor: | BCLA, CALCIUM ION, SULFATE ION, ... | | Authors: | Lameignere, E, Malinovska, L, Mitchell, E.P, Imberty, A, Wimmerova, M. | | Deposit date: | 2008-02-07 | | Release date: | 2008-04-08 | | Last modified: | 2024-05-08 | | Method: | X-RAY DIFFRACTION (1.7 Å) | | Cite: | Structural Basis for Mannose Recognition by a Lectin from Opportunistic Bacteria Burkholderia Cenocepacia
Biochem.J., 411, 2008
|
|
3GPP
 | | MutM encountering an intrahelical 8-oxoguanine (oxoG) lesion in EC3-T224P complex | | Descriptor: | DNA (5'-D(P*CP*GP*TP*CP*CP*(8OG)P*GP*AP*TP*CP*TP*AP*C)-3'), DNA (5'-D(P*GP*GP*TP*AP*GP*AP*TP*CP*CP*GP*GP*AP*C)-3'), DNA glycosylase, ... | | Authors: | Spong, M.C, Qi, Y, Verdine, G.L. | | Deposit date: | 2009-03-23 | | Release date: | 2009-11-10 | | Last modified: | 2023-09-06 | | Method: | X-RAY DIFFRACTION (2.15 Å) | | Cite: | Encounter and extrusion of an intrahelical lesion by a DNA repair enzyme.
Nature, 462, 2009
|
|
6K5Q
 | | Crystal structure of lysozyme complexed with a bioactive compound from Jatropha gossypiifolia | | Descriptor: | ACETATE ION, GLYCEROL, Lysozyme C, ... | | Authors: | Kanal Elamparithi, B, Ankur, T, Sivakumar, M, Gunasekaran, K. | | Deposit date: | 2019-05-30 | | Release date: | 2020-05-27 | | Last modified: | 2024-11-06 | | Method: | X-RAY DIFFRACTION (1.177 Å) | | Cite: | Crystal structure of lysozyme complexed with a bioactive compound from Jatropha gossypiifolia
To Be Published
|
|
3GPY
 | | Sequence-matched MutM Lesion Recognition Complex 3 (LRC3) | | Descriptor: | DNA (5'-D(*AP*GP*GP*TP*AP*GP*AP*TP*CP*CP*GP*GP*AP*CP*GP*C)-3'), DNA (5'-D(*T*GP*CP*GP*TP*CP*CP*(8OG)P*GP*AP*TP*CP*TP*AP*CP*C)-3'), DNA glycosylase, ... | | Authors: | Qi, Y, Verdine, G.L. | | Deposit date: | 2009-03-23 | | Release date: | 2009-11-10 | | Last modified: | 2023-09-06 | | Method: | X-RAY DIFFRACTION (1.85 Å) | | Cite: | Encounter and extrusion of an intrahelical lesion by a DNA repair enzyme.
Nature, 462, 2009
|
|
4Q10
 | | The catalytic core of Rad2 in complex with DNA substrate (complex IV) | | Descriptor: | CALCIUM ION, DNA (5'-D(*TP*TP*TP*TP*CP*TP*GP*AP*GP*AP*CP*AP*AP*GP*GP*GP*AP*GP*CP*TP*TP*TP*T)-3'), DNA (5'-D(*TP*TP*TP*TP*GP*CP*TP*CP*CP*CP*TP*TP*GP*TP*CP*TP*CP*AP*GP*TP*TP*TP*T)-3'), ... | | Authors: | Mietus, M, Nowak, E, Jaciuk, M, Kustosz, P, Nowotny, M. | | Deposit date: | 2014-04-02 | | Release date: | 2014-08-27 | | Last modified: | 2023-09-20 | | Method: | X-RAY DIFFRACTION (2.7 Å) | | Cite: | Crystal structure of the catalytic core of Rad2: insights into the mechanism of substrate binding.
Nucleic Acids Res., 42, 2014
|
|
2MUG
 | | Protective cellular immunity against P. falciparum malaria merozoite is associated with a different P7 and P8 residue orientation in the MHC-peptide-TCR complex | | Descriptor: | Serine-repeat antigen protein | | Authors: | Patarroyo, M, Salazar, L, Cifuentes, G, Lozano, J, Delgado, G, Rivera, Z, Rosas, J, Vargas, L. | | Deposit date: | 2014-09-09 | | Release date: | 2014-10-01 | | Last modified: | 2024-10-16 | | Method: | SOLUTION NMR | | Cite: | Protective cellular immunity against P. falciparum malaria merozoites is associated with a different P7 and P8 residue orientation in the MHC-peptide-TCR complex.
Biochimie, 88, 2006
|
|
3GXK
 | | The crystal structure of g-type lysozyme from Atlantic cod (Gadus morhua L.) in complex with NAG oligomers sheds new light on substrate binding and the catalytic mechanism. Native structure to 1.9 | | Descriptor: | COBALT (II) ION, Goose-type lysozyme 1 | | Authors: | Helland, R, Larsen, R.L, Finstad, S, Kyomuhendo, P, Larsen, A.N. | | Deposit date: | 2009-04-02 | | Release date: | 2009-10-20 | | Last modified: | 2023-11-01 | | Method: | X-RAY DIFFRACTION (1.9 Å) | | Cite: | Crystal structures of g-type lysozyme from Atlantic cod shed new light on substrate binding and the catalytic mechanism.
Cell.Mol.Life Sci., 66, 2009
|
|
3EF9
 | | Replacement of Val3 in Human Thymidylate Synthase Affects Its Kinetic Properties and Intracellular Stability | | Descriptor: | SULFATE ION, Thymidylate synthase | | Authors: | Huang, X, Gibson, L.M, Bell, B.J, Lovelace, L.L, Pena, M.M, Berger, F.G, Berger, S.H. | | Deposit date: | 2008-09-08 | | Release date: | 2010-03-02 | | Last modified: | 2024-02-21 | | Method: | X-RAY DIFFRACTION (3.2 Å) | | Cite: | Replacement of Val3 in human thymidylate synthase affects its kinetic properties and intracellular stability .
Biochemistry, 49, 2010
|
|
7G2V
 | | Crystal Structure of rat Autotaxin in complex with 4-[3-[(2-tert-butyl-4-chloro-5-methylphenyl)methoxy]-4,5,7,8-tetrahydro-1H-pyrazolo[3,4-d]azepine-6-carbonyl]-2,3-difluorobenzenesulfonamide, i.e. SMILES c1(c(c(c(cc1)C(=O)N1CCC2=C(CC1)NN=C2OCc1c(cc(c(c1)C)Cl)C(C)(C)C)F)F)S(=O)(=O)N with IC50=0.0130576 microM | | Descriptor: | 4-{3-[(2-tert-butyl-4-chloro-5-methylphenyl)methoxy]-4,5,7,8-tetrahydropyrazolo[3,4-d]azepine-6(1H)-carbonyl}-2,3-difluorobenzene-1-sulfonamide, ACETATE ION, CALCIUM ION, ... | | Authors: | Stihle, M, Benz, J, Hunziker, D, Rudolph, M.G. | | Deposit date: | 2023-06-05 | | Release date: | 2024-12-18 | | Method: | X-RAY DIFFRACTION (1.52 Å) | | Cite: | Crystal Structure of a rat Autotaxin complex
To be published
|
|
4BNC
 | | Crystal structure of the DNA-binding domain of human ETV1 complexed with DNA | | Descriptor: | 5'-D(*AP*CP*CP*GP*GP*AP*AP*GP*TP*GP)-3', 5'-D(*CP*AP*CP*TP*TP*CP*CP*GP*GP*TP)-3', HUMAN ETV1 | | Authors: | Allerston, C.K, Cooper, C.D.O, Krojer, T, Chaikuad, A, Vollmar, M, Froese, D.S, Arrowsmith, C.H, Edwards, A, Bountra, C, von Delft, F, Gileadi, O. | | Deposit date: | 2013-05-14 | | Release date: | 2013-07-03 | | Last modified: | 2024-05-08 | | Method: | X-RAY DIFFRACTION (2.9 Å) | | Cite: | Structures of the Ets Domains of Transcription Factors Etv1, Etv4, Etv5 and Fev: Determinants of DNA Binding and Redox Regulation by Disulfide Bond Formation.
J.Biol.Chem., 290, 2015
|
|
7G37
 | | Crystal Structure of rat Autotaxin in complex with 1H-benzotriazol-5-yl-[rac-(1R,2S,6R,7S)-9-[5-chloro-4-(cyclopropylmethoxy)pyridine-2-carbonyl]-4,9-diazatricyclo[5.3.0.02,6]decan-4-yl]methanone, i.e. SMILES N1(C[C@H]2[C@@H](C1)[C@H]1[C@@H]2CN(C1)C(=O)c1ccc2c(c1)N=NN2)C(=O)c1cc(c(cn1)Cl)OCC1CC1 with IC50=0.190022 microM | | Descriptor: | ACETATE ION, CALCIUM ION, CHLORIDE ION, ... | | Authors: | Stihle, M, Benz, J, Hunziker, D, Mattei, P, Rudolph, M.G. | | Deposit date: | 2023-06-05 | | Release date: | 2024-12-18 | | Method: | X-RAY DIFFRACTION (1.77 Å) | | Cite: | Crystal Structure of a rat Autotaxin complex
To be published
|
|
3EJQ
 | | Golgi alpha-Mannosidase II in complex with 5-substitued swainsonine analog: (5R)-5-[2'-oxo-2'-(4-methylphenyl)ethyl]-swainsonine | | Descriptor: | (4R)-2-METHYLPENTANE-2,4-DIOL, 1-(4-methylphenyl)-2-[(1S,2R,5R,8R,8aR)-1,2,8-trihydroxyoctahydroindolizin-5-yl]ethanone, 2-acetamido-2-deoxy-beta-D-glucopyranose, ... | | Authors: | Kuntz, D.A, Rose, D.R. | | Deposit date: | 2008-09-18 | | Release date: | 2009-10-13 | | Last modified: | 2024-10-16 | | Method: | X-RAY DIFFRACTION (1.45 Å) | | Cite: | Structural Investigation of the Binding of 5-Substituted Swainsonine Analogues to Golgi alpha-Mannosidase II.
Chembiochem, 11, 2010
|
|
6KAF
 | | C2S2M2N2-type PSII-LHCII | | Descriptor: | (1R,3R)-6-{(3E,5E,7E,9E,11E,13E,15E,17E)-18-[(1S,4R,6R)-4-HYDROXY-2,2,6-TRIMETHYL-7-OXABICYCLO[4.1.0]HEPT-1-YL]-3,7,12,16-TETRAMETHYLOCTADECA-1,3,5,7,9,11,13,15,17-NONAENYLIDENE}-1,5,5-TRIMETHYLCYCLOHEXANE-1,3-DIOL, (3R,3'R,6S)-4,5-DIDEHYDRO-5,6-DIHYDRO-BETA,BETA-CAROTENE-3,3'-DIOL, (3S,5R,6S,3'S,5'R,6'S)-5,6,5',6'-DIEPOXY-5,6,5',6'- TETRAHYDRO-BETA,BETA-CAROTENE-3,3'-DIOL, ... | | Authors: | Chang, S.H, Shen, L.L, Huang, Z.H, Wang, W.D, Han, G.Y, Shen, J.R, Zhang, X. | | Deposit date: | 2019-06-22 | | Release date: | 2019-10-23 | | Last modified: | 2025-04-09 | | Method: | ELECTRON MICROSCOPY (3.73 Å) | | Cite: | Structure of a C2S2M2N2-type PSII-LHCII supercomplex from the green algaChlamydomonas reinhardtii.
Proc.Natl.Acad.Sci.USA, 116, 2019
|
|
7DH0
 | | Activity optimized complex I (open form) | | Descriptor: | 1,2-DIACYL-SN-GLYCERO-3-PHOSPHOCHOLINE, 1,2-Distearoyl-sn-glycerophosphoethanolamine, Acyl carrier protein, ... | | Authors: | Jeon, T.J, Lee, S.G, Yoo, S.H, Ryu, J.H, Kim, D.S, Hyun, J.K, Kim, H.M, Ryu, S.E. | | Deposit date: | 2020-11-12 | | Release date: | 2022-05-18 | | Method: | ELECTRON MICROSCOPY (4.2 Å) | | Cite: | A Dynamic Substrate Pool Revealed by cryo-EM of a Lipid-Preserved Respiratory Supercomplex.
Antioxid.Redox Signal., 2022
|
|
3GPX
 | | Sequence-matched MutM Interrogation Complex 4 (IC4) | | Descriptor: | DNA (5'-D(*A*GP*GP*TP*AP*GP*AP*CP*TP*CP*GP*GP*AP*CP*GP*C)-3'), DNA (5'-D(*TP*GP*CP*GP*TP*CP*CP*GP*AP*GP*TP*CP*TP*AP*CP*C)-3'), DNA glycosylase, ... | | Authors: | Spong, M.C, Qi, Y, Verdine, G.L. | | Deposit date: | 2009-03-23 | | Release date: | 2009-11-10 | | Last modified: | 2024-02-21 | | Method: | X-RAY DIFFRACTION (1.78 Å) | | Cite: | Encounter and extrusion of an intrahelical lesion by a DNA repair enzyme.
Nature, 462, 2009
|
|
7DKF
 | | Activity optimized supercomplex state4 | | Descriptor: | 1,2-DIACYL-SN-GLYCERO-3-PHOSPHOCHOLINE, 1,2-Distearoyl-sn-glycerophosphoethanolamine, Acyl carrier protein, ... | | Authors: | Jeon, T.J, Lee, S.G, Yoo, S.H, Ryu, J.H, Kim, D.S, Hyun, J.K, Kim, H.M, Ryu, S.E. | | Deposit date: | 2020-11-24 | | Release date: | 2022-05-18 | | Method: | ELECTRON MICROSCOPY (8.3 Å) | | Cite: | A Dynamic Substrate Pool Revealed by cryo-EM of a Lipid-Preserved Respiratory Supercomplex.
Antioxid.Redox Signal., 2022
|
|
