1CFF
 
 | | NMR SOLUTION STRUCTURE OF A COMPLEX OF CALMODULIN WITH A BINDING PEPTIDE OF THE CA2+-PUMP | | Descriptor: | CALCIUM ION, CALCIUM PUMP, CALMODULIN | | Authors: | Elshorst, B, Hennig, M, Foersterling, H, Diener, A, Maurer, M, Schulte, P, Schwalbe, H, Krebs, J, Schmid, H, Vorherr, T, Carafoli, E, Griesinger, C. | | Deposit date: | 1999-03-18 | | Release date: | 1999-09-24 | | Last modified: | 2023-12-27 | | Method: | SOLUTION NMR | | Cite: | NMR solution structure of a complex of calmodulin with a binding peptide of the Ca2+ pump.
Biochemistry, 38, 1999
|
|
1HXV
 | | PPIASE DOMAIN OF THE MYCOPLASMA GENITALIUM TRIGGER FACTOR | | Descriptor: | TRIGGER FACTOR | | Authors: | Vogtherr, M, Parac, T.N, Maurer, M, Pahl, A, Fiebig, K. | | Deposit date: | 2001-01-17 | | Release date: | 2002-05-29 | | Last modified: | 2024-05-22 | | Method: | SOLUTION NMR | | Cite: | NMR solution structure and dynamics of the peptidyl-prolyl cis-trans isomerase domain of the trigger factor from Mycoplasma genitalium compared to FK506-binding protein.
J.Mol.Biol., 318, 2002
|
|
7DXJ
 | |
7DXK
 | |
6Z5N
 | | DnaJB1 JD-GF | | Descriptor: | DnaJ homolog subfamily B member 1 | | Authors: | Avraham-Abayev, M, London, N, Rosenzweig, R. | | Deposit date: | 2020-05-27 | | Release date: | 2020-11-18 | | Last modified: | 2024-06-19 | | Method: | SOLUTION NMR | | Cite: | HSP40 proteins use class-specific regulation to drive HSP70 functional diversity.
Nature, 587, 2020
|
|
6EZ8
 | | Human Huntingtin-HAP40 complex structure | | Descriptor: | Factor VIII intron 22 protein, Huntingtin | | Authors: | Guo, Q, Bin, H, Cheng, J, Pfeifer, G, Baumeister, W, Fernandez-Busnadiego, R, Kochanek, S. | | Deposit date: | 2017-11-14 | | Release date: | 2018-02-21 | | Last modified: | 2019-12-11 | | Method: | ELECTRON MICROSCOPY (4 Å) | | Cite: | The cryo-electron microscopy structure of huntingtin.
Nature, 555, 2018
|
|
6EM9
 | | S.aureus ClpC resting state, asymmetric map | | Descriptor: | ATP-dependent Clp protease ATP-binding subunit ClpC | | Authors: | Carroni, M, Mogk, A, Bukau, B, Franke, K. | | Deposit date: | 2017-10-01 | | Release date: | 2017-12-27 | | Last modified: | 2024-05-15 | | Method: | ELECTRON MICROSCOPY (8.4 Å) | | Cite: | Regulatory coiled-coil domains promote head-to-head assemblies of AAA+ chaperones essential for tunable activity control.
Elife, 6, 2017
|
|
6EM8
 | | S.aureus ClpC resting state, C2 symmetrised | | Descriptor: | ATP-dependent Clp protease ATP-binding subunit ClpC | | Authors: | Carroni, M, Mogk, A. | | Deposit date: | 2017-10-01 | | Release date: | 2017-12-27 | | Last modified: | 2024-05-15 | | Method: | ELECTRON MICROSCOPY (8.4 Å) | | Cite: | Regulatory coiled-coil domains promote head-to-head assemblies of AAA+ chaperones essential for tunable activity control.
Elife, 6, 2017
|
|
6EMW
 | | Structure of S.aureus ClpC in complex with MecA | | Descriptor: | ATP-dependent Clp protease ATP-binding subunit, ATP-dependent Clp protease ATP-binding subunit ClpC, Adapter protein MecA, ... | | Authors: | Carroni, M, Mogk, A, Bukau, B, Franke, K. | | Deposit date: | 2017-10-03 | | Release date: | 2017-12-27 | | Last modified: | 2024-05-15 | | Method: | ELECTRON MICROSCOPY (11 Å) | | Cite: | Regulatory coiled-coil domains promote head-to-head assemblies of AAA+ chaperones essential for tunable activity control.
Elife, 6, 2017
|
|
5SJ0
 | | CRYSTAL STRUCTURE OF HUMAN PHOSPHODIESTERASE 10 IN COMPLEX WITH c12c([nH]cn1)ncnc2N(C)C3CCCCC3, micromolar IC50=3.41927 | | Descriptor: | MAGNESIUM ION, N-cyclohexyl-N-methyl-7H-purin-6-amine, ZINC ION, ... | | Authors: | Joseph, C, Benz, J, Flohr, A, Maurer, M, Rudolph, M.G. | | Deposit date: | 2022-02-01 | | Release date: | 2022-10-12 | | Last modified: | 2024-10-16 | | Method: | X-RAY DIFFRACTION (2.35 Å) | | Cite: | Crystal Structure of a human phosphodiesterase 10 complex
To be published
|
|
7G0T
 | | Crystal Structure of human FABP4 in complex with 1-[[4-chloro-2-(trifluoromethyl)phenyl]carbamoylamino]cyclopentane-1-carboxylic acid | | Descriptor: | 1-{[4-chloro-2-(trifluoromethyl)phenyl]carbamamido}cyclopentane-1-carboxylic acid, DIMETHYL SULFOXIDE, FORMIC ACID, ... | | Authors: | Ehler, A, Benz, J, Obst, U, Maurer, M, Rudolph, M.G. | | Deposit date: | 2023-04-27 | | Release date: | 2023-06-14 | | Last modified: | 2024-04-03 | | Method: | X-RAY DIFFRACTION (1.65 Å) | | Cite: | Crystal Structure of a human FABP4 complex
To be published
|
|
7FZR
 | | Crystal Structure of human FABP4 in complex with 4-hydroxy-6-(2-naphthalen-1-ylethyl)pyran-2-one | | Descriptor: | 4-hydroxy-6-[2-(naphthalen-1-yl)ethyl]-2H-pyran-2-one, FORMIC ACID, Fatty acid-binding protein, ... | | Authors: | Ehler, A, Benz, J, Obst, U, Maurer, M, Rudolph, M.G. | | Deposit date: | 2023-04-27 | | Release date: | 2023-06-14 | | Last modified: | 2024-04-03 | | Method: | X-RAY DIFFRACTION (1.12 Å) | | Cite: | Crystal Structure of a human FABP4 complex
To be published
|
|
