9DC8
Mtb GuaB dCBS in complex with inhibitor G1
Entity
| Entity ID | Chain ID | Description | Type | Chain length | Formula weight | Number of molecules | DB Name (Accession) | Biological source | Descriptive keywords |
| 1 | A (A) | Inosine-5'-monophosphate dehydrogenase | polymer | 422 | 43453.5 | 1 | UniProt (P9WKI7) Pfam (PF00478) | Mycobacterium tuberculosis | IMP dehydrogenase,IMPD,IMPDH,IMPDH2 |
| 2 | B (A) | INOSINIC ACID | non-polymer | 348.2 | 1 | Chemie (IMP) | |||
| 3 | C, D, E (A) | N-(6-chloropyridin-3-yl)-N~2~-(1,4-dihydro-2H-pyrano[3,4-c]quinolin-9-yl)-L-alaninamide | non-polymer | 382.8 | 3 | Chemie (VOA) | |||
| 4 | F (A) | SULFATE ION | non-polymer | 96.1 | 1 | Chemie (SO4) | |||
| 5 | G (A) | water | water | 18.0 | 203 | Chemie (HOH) |
Sequence modifications
A: 2 - 125 (UniProt: P9WKI7)
A: 253 - 529 (UniProt: P9WKI7)
| PDB | External Database | Details |
|---|---|---|
| Met -14 | - | initiating methionine |
| His -13 | - | expression tag |
| His -12 | - | expression tag |
| His -11 | - | expression tag |
| His -10 | - | expression tag |
| His -9 | - | expression tag |
| His -8 | - | expression tag |
| Gly -7 | - | expression tag |
| Glu -6 | - | expression tag |
| Asn -5 | - | expression tag |
| Leu -4 | - | expression tag |
| Tyr -3 | - | expression tag |
| Phe -2 | - | expression tag |
| Gln -1 | - | expression tag |
| Gly 0 | - | expression tag |
| Ser 1 | - | expression tag |
| PDB | External Database | Details |
|---|---|---|
| Gly 126 | - | linker |
| Gly 127 | - | linker |
| Gly 530 | - | expression tag |
| Asn 531 | - | expression tag |
| Ser 532 | - | expression tag |
Sequence viewer
Contents of the asymmetric unit
| Polymers | Number of chains | 1 |
| Total formula weight | 43453.5 | |
| Non-Polymers* | Number of molecules | 5 |
| Total formula weight | 1592.8 | |
| All* | Total formula weight | 45046.3 |
