7G0E
Crystal Structure of human FABP5 in complex with 2-[(3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamoyl]cyclopentene-1-carboxylic acid, i.e. SMILES C1CCC2=C(C1)C(=C(S2)NC(=O)C1=C(C(=O)O)CCC1)C(=O)OCC with IC50=1.1 microM
Entity
| Entity ID | Chain ID | Description | Type | Chain length | Formula weight | Number of molecules | DB Name (Accession) | Biological source | Descriptive keywords |
| 1 | A (A) | Fatty acid-binding protein 5 | polymer | 138 | 15467.7 | 1 | UniProt (Q01469) Pfam (PF00061) | Homo sapiens (human) | Epidermal-type fatty acid-binding protein,E-FABP,Fatty acid-binding protein,epidermal,Psoriasis-associated fatty acid-binding protein homolog,PA-FABP |
| 2 | B (A) | DIMETHYL SULFOXIDE | non-polymer | 78.1 | 1 | Chemie (DMS) | |||
| 3 | C, D (A) | 2-{[3-(ethoxycarbonyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl}cyclopent-1-ene-1-carboxylic acid | non-polymer | 363.4 | 2 | Chemie (L8T) | |||
| 4 | E (A) | SULFATE ION | non-polymer | 96.1 | 1 | Chemie (SO4) | |||
| 5 | F (A) | CHLORIDE ION | non-polymer | 35.5 | 1 | Chemie (CL) | |||
| 6 | G (A) | water | water | 18.0 | 136 | Chemie (HOH) |
Sequence modifications
A: 1 - 135 (UniProt: Q01469)
| PDB | External Database | Details |
|---|---|---|
| Gly -2 | - | expression tag |
| Ser -1 | - | expression tag |
| His 0 | - | expression tag |
Sequence viewer
Contents of the asymmetric unit
| Polymers | Number of chains | 1 |
| Total formula weight | 15467.7 | |
| Non-Polymers* | Number of molecules | 5 |
| Total formula weight | 936.5 | |
| All* | Total formula weight | 16404.2 |






