7FZD
Crystal Structure of human FABP4 in complex with 3-(4-chlorophenyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazole-5-carboxylic acid, i.e. SMILES [C@@H]12C(=NO[C@@H]1C[C@H](C2)C(=O)O)c1ccc(cc1)Cl with IC50=6.1 microM
Entity
Entity ID | Chain ID | Description | Type | Chain length | Formula weight | Number of molecules | DB Name (Accession) | Biological source | Descriptive keywords |
1 | A (A) | Fatty acid-binding protein, adipocyte | polymer | 135 | 15022.2 | 1 | UniProt (P15090) Pfam (PF00061) | Homo sapiens (human) | Adipocyte lipid-binding protein,ALBP,Adipocyte-type fatty acid-binding protein,A-FABP,AFABP,Fatty acid-binding protein 4 |
2 | B (A) | (3aS,5R,6aS)-3-(4-chlorophenyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazole-5-carboxylic acid | non-polymer | 265.7 | 1 | Chemie (WFC) | |||
3 | C, F (A) | SULFATE ION | non-polymer | 96.1 | 2 | Chemie (SO4) | |||
4 | D (A) | FORMIC ACID | non-polymer | 46.0 | 1 | Chemie (FMT) | |||
5 | E (A) | (1R,3R,4S)-3-(4-chlorobenzoyl)-4-hydroxycyclopentane-1-carboxylic acid | non-polymer | 268.7 | 1 | Chemie (WFK) | |||
6 | G (A) | water | water | 18.0 | 228 | Chemie (HOH) |
Sequence modifications
A: 0 - 131 (UniProt: P15090)
PDB | External Database | Details |
---|---|---|
Gly -3 | - | expression tag |
Ser -2 | - | expression tag |
His -1 | - | expression tag |
Sequence viewer
Contents of the asymmetric unit
Polymers | Number of chains | 1 |
Total formula weight | 15022.2 | |
Non-Polymers* | Number of molecules | 5 |
Total formula weight | 772.5 | |
All* | Total formula weight | 15794.7 |