7FYM
Crystal Structure of human FABP4 binding site mutated to that of FABP5 in complex with 5-(3-bromo-4-methylphenyl)-3,3-dimethyl-5-oxopentanoic acid, i.e. SMILES c1(C(=O)CC(CC(=O)O)(C)C)cc(c(cc1)C)Br with IC50=5.1 microM
Entity
Entity ID | Chain ID | Description | Type | Chain length | Formula weight | Number of molecules | DB Name (Accession) | Biological source | Descriptive keywords |
1 | A (A) | Fatty acid-binding protein, adipocyte | polymer | 135 | 15012.2 | 1 | UniProt (P15090) Pfam (PF00061) | Homo sapiens (human) | Adipocyte lipid-binding protein,ALBP,Adipocyte-type fatty acid-binding protein,A-FABP,AFABP,Fatty acid-binding protein 4 |
2 | B (A) | 5-(3-bromo-4-methylphenyl)-3,3-dimethyl-5-oxopentanoic acid | non-polymer | 313.2 | 1 | Chemie (W8N) | |||
3 | C (A) | TETRAETHYLENE GLYCOL | non-polymer | 194.2 | 1 | Chemie (PG4) | |||
4 | D (A) | DIMETHYL SULFOXIDE | non-polymer | 78.1 | 1 | Chemie (DMS) | |||
5 | E (A) | water | water | 18.0 | 174 | Chemie (HOH) |
Sequence modifications
A: 0 - 131 (UniProt: P15090)
PDB | External Database | Details |
---|---|---|
Gly -3 | - | expression tag |
Ser -2 | - | expression tag |
His -1 | - | expression tag |
Leu 23 | Val 24 | engineered mutation |
Met 32 | Val 33 | engineered mutation |
Gly 33 | Ala 34 | engineered mutation |
Cys 40 | Met 41 | engineered mutation |
Thr 53 | Ser 54 | engineered mutation |
Leu 57 | Phe 58 | engineered mutation |
Gln 93 | His 94 | engineered mutation |
Cys 124 | Ser 125 | engineered mutation |
Sequence viewer
Contents of the asymmetric unit
Polymers | Number of chains | 1 |
Total formula weight | 15012.2 | |
Non-Polymers* | Number of molecules | 3 |
Total formula weight | 585.5 | |
All* | Total formula weight | 15597.8 |