7FXX
Crystal Structure of human FABP4 binding site mutated to that of FABP3 in complex with 6-cyclopentyl-N,5-dimethyl-4-phenyl-N-propan-2-yl-3-(1H-tetrazol-5-yl)pyridin-2-amine, i.e. SMILES c1(c(nc(c(c1c1ccccc1)C1=NN=NN1)N(C(C)C)C)C1CCCC1)C with IC50=0.171959 microM
Entity
Entity ID | Chain ID | Description | Type | Chain length | Formula weight | Number of molecules | DB Name (Accession) | Biological source | Descriptive keywords |
1 | A (A) | Fatty acid-binding protein, adipocyte | polymer | 135 | 15060.2 | 1 | UniProt (P15090) Pfam (PF00061) | Homo sapiens (human) | Adipocyte lipid-binding protein,ALBP,Adipocyte-type fatty acid-binding protein,A-FABP,AFABP,Fatty acid-binding protein 4 |
2 | B (A) | (3P)-6-cyclopentyl-N,5-dimethyl-4-phenyl-N-(propan-2-yl)-3-(1H-tetrazol-5-yl)pyridin-2-amine | non-polymer | 376.5 | 1 | Chemie (Q1I) | |||
3 | C, E (A) | SULFATE ION | non-polymer | 96.1 | 2 | Chemie (SO4) | |||
4 | D (A) | CHLORIDE ION | non-polymer | 35.5 | 1 | Chemie (CL) | |||
5 | F (A) | water | water | 18.0 | 150 | Chemie (HOH) |
Sequence modifications
A: 0 - 131 (UniProt: P15090)
PDB | External Database | Details |
---|---|---|
Gly -3 | - | expression tag |
Ser -2 | - | expression tag |
His -1 | - | expression tag |
Leu 23 | Val 24 | engineered mutation |
Thr 40 | Met 41 | engineered mutation |
Leu 51 | Ile 52 | engineered mutation |
Thr 53 | Ser 54 | engineered mutation |
Leu 104 | Ile 105 | engineered mutation |
Leu 115 | Val 116 | engineered mutation |
Leu 117 | Cys 118 | engineered mutation |
Cys 124 | Ser 125 | engineered mutation |
Sequence viewer
Contents of the asymmetric unit
Polymers | Number of chains | 1 |
Total formula weight | 15060.2 | |
Non-Polymers* | Number of molecules | 4 |
Total formula weight | 604.1 | |
All* | Total formula weight | 15664.3 |