7FXS
Crystal Structure of human FABP4 binding site mutated to that of FABP5 in complex with 5-phenoxy-6-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)pyridine-3-carboxylic acid, i.e. SMILES c1(c(nc(c(c1)C(=O)O)C(F)(F)F)OCC(F)(F)F)Oc1ccccc1 with IC50=2.33933 microM
Entity
| Entity ID | Chain ID | Description | Type | Chain length | Formula weight | Number of molecules | DB Name (Accession) | Biological source | Descriptive keywords |
| 1 | A (A) | Fatty acid-binding protein, adipocyte | polymer | 135 | 15012.2 | 1 | UniProt (P15090) Pfam (PF00061) | Homo sapiens (human) | Adipocyte lipid-binding protein,ALBP,Adipocyte-type fatty acid-binding protein,A-FABP,AFABP,Fatty acid-binding protein 4 |
| 2 | B, C, E (A) | DIMETHYL SULFOXIDE | non-polymer | 78.1 | 3 | Chemie (DMS) PubChem (679) | |||
| 3 | D (A) | 5-phenoxy-6-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)pyridine-3-carboxylic acid | non-polymer | 381.2 | 1 | Chemie (TXO) PubChem (168300870) | |||
| 4 | F (A) | water | water | 18.0 | 179 | Chemie (HOH) |
Sequence modifications
A: 0 - 131 (UniProt: P15090)
| PDB | External Database | Details |
|---|---|---|
| Gly -3 | - | expression tag |
| Ser -2 | - | expression tag |
| His -1 | - | expression tag |
| Leu 23 | Val 24 | engineered mutation |
| Met 32 | Val 33 | engineered mutation |
| Gly 33 | Ala 34 | engineered mutation |
| Cys 40 | Met 41 | engineered mutation |
| Thr 53 | Ser 54 | engineered mutation |
| Leu 57 | Phe 58 | engineered mutation |
| Gln 93 | His 94 | engineered mutation |
| Cys 124 | Ser 125 | engineered mutation |
Sequence viewer
Contents of the asymmetric unit
| Polymers | Number of chains | 1 |
| Total formula weight | 15012.2 | |
| Non-Polymers* | Number of molecules | 4 |
| Total formula weight | 615.6 | |
| All* | Total formula weight | 15627.9 |






