5SGO
CRYSTAL STRUCTURE OF HUMAN PHOSPHODIESTERASE 10 IN COMPLEX WITH n1cnc(c2c1scc2c3ccc(cc3)F)OCCCOc4cc(ccc4)NC(=O)C, micromolar IC50=0.012
Entity
| Entity ID | Chain ID | Description | Type | Chain length | Formula weight | Number of molecules | DB Name (Accession) | Biological source | Descriptive keywords |
| 1 | A, B, D (A, B, D) | cAMP and cAMP-inhibited cGMP 3',5'-cyclic phosphodiesterase 10A | polymer | 343 | 39337.1 | 3 | UniProt (Q9Y233) Pfam (PF00233) | Homo sapiens (human) | |
| 2 | C (C) | cAMP and cAMP-inhibited cGMP 3',5'-cyclic phosphodiesterase 10A | polymer | 343 | 39413.2 | 1 | Pfam (PF00233) UniProt (by SIFTS) (Q9Y233) | Homo sapiens (human) | |
| 3 | E, G, I, K (A, B, C, D) | ZINC ION | non-polymer | 65.4 | 4 | Chemie (ZN) | |||
| 4 | F, H, J, L (A, B, C, D) | N-[3-(3-{[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]oxy}propoxy)phenyl]acetamide | non-polymer | 437.5 | 4 | Chemie (IYA) | |||
| 5 | M, N, O, P (A, B, C, D) | water | water | 18.0 | 329 | Chemie (HOH) |
Sequence modifications
A, B, D: 449 - 789 (UniProt: Q9Y233)
| PDB | External Database | Details |
|---|---|---|
| Gly 447 | - | expression tag |
| Ser 448 | - | expression tag |
Sequence viewer
Contents of the asymmetric unit
| Polymers | Number of chains | 4 |
| Total formula weight | 157424.5 | |
| Non-Polymers* | Number of molecules | 8 |
| Total formula weight | 2011.6 | |
| All* | Total formula weight | 159436.0 |






