5SG4
CRYSTAL STRUCTURE OF HUMAN PHOSPHODIESTERASE 10 IN COMPLEX WITH N(C(=O)c1c(cnn1C)C(=O)N)c3ccc2[nH]c(nc2c3)c4cccc(c4)Cl, micromolar IC50=0.009485
Entity
Entity ID | Chain ID | Description | Type | Chain length | Formula weight | Number of molecules | DB Name (Accession) | Biological source | Descriptive keywords |
1 | A | cAMP and cAMP-inhibited cGMP 3',5'-cyclic phosphodiesterase 10A | polymer | 343 | 39413.2 | 1 | UniProt (Q9Y233) In PDB | Homo sapiens (human) | |
2 | A | ZINC ION | non-polymer | 65.4 | 1 | Chemie (ZN) | |||
3 | A | MAGNESIUM ION | non-polymer | 24.3 | 1 | Chemie (MG) | |||
4 | A | N~5~-[2-(3-chlorophenyl)-1H-benzimidazol-5-yl]-1-methyl-1H-pyrazole-4,5-dicarboxamide | non-polymer | 394.8 | 1 | Chemie (IVJ) | |||
5 | water | water | 18.0 | 150 | Chemie (HOH) |
Sequence modifications
A: 449 - 789 (UniProt: Q9Y233)
PDB | External Database | Details |
---|---|---|
Gly 447 | - | expression tag |
Ser 448 | - | expression tag |
Sequence viewer
Contents of the asymmetric unit
Polymers | Number of chains | 1 |
Total formula weight | 39413.2 | |
Non-Polymers* | Number of molecules | 3 |
Total formula weight | 484.5 | |
All* | Total formula weight | 39897.7 |