4DVX
Crystal structure of clade A/E 93TH057 HIV-1 gp120 core in complex with MAE-II-188
Entity
| Entity ID | Chain ID | Description | Type | Chain length | Formula weight | Number of molecules | DB Name (Accession) | Biological source | Descriptive keywords |
| 1 | A, B (A, B) | clade A/E 93TH057 HIV-1 gp120 core | polymer | 353 | 39160.4 | 2 | UniProt (A0A0M3KKW9) | Human immunodeficiency virus 1 | |
| 2 | C, D, E, F, G... (A, B) | 2-acetamido-2-deoxy-beta-D-glucopyranose | non-polymer | 221.2 | 22 | Chemie (NAG) | |||
| 3 | AA, N (B, A) | N-(4-chloro-3-fluorophenyl)-N'-{[(3R)-1-cyclopropylpyrrolidin-3-yl]methyl}ethanediamide | non-polymer | 339.8 | 2 | Chemie (0M5) PubChem (46198493) | |||
| 4 | BA, O (B, A) | 4-(2-HYDROXYETHYL)-1-PIPERAZINE ETHANESULFONIC ACID | non-polymer | 238.3 | 2 | Chemie (EPE) PubChem (23831) | |||
| 5 | CA, DA (A, B) | water | water | 18.0 | 96 | Chemie (HOH) |
Sequence modifications
A, B: 44 - 492 (UniProt: A0A0M3KKW9)
| PDB | External Database | Details |
|---|---|---|
| Ser 375 | His 242 | engineered mutation |
Sequence viewer
Contents of the asymmetric unit
| Polymers | Number of chains | 2 |
| Total formula weight | 78320.7 | |
| Non-Polymers* | Number of molecules | 26 |
| Total formula weight | 6022.8 | |
| All* | Total formula weight | 84343.5 |






