4DVW
Crystal structure of clade A/E 93TH057 HIV-1 gp120 core in complex with MAE-II-167
Entity
Entity ID | Chain ID | Description | Type | Chain length | Formula weight | Number of molecules | DB Name (Accession) | Biological source | Descriptive keywords |
1 | A, B | clade A/E 93TH057 HIV-1 gp120 core | polymer | 353 | 39160.4 | 2 | UniProt (A0A0M3KKW9) Pfam (PF00516) In PDB | Human immunodeficiency virus 1 | |
2 | A, B | 2-acetamido-2-deoxy-beta-D-glucopyranose | non-polymer | 221.2 | 20 | Chemie (NAG) | |||
3 | A, B | 4-(2-HYDROXYETHYL)-1-PIPERAZINE ETHANESULFONIC ACID | non-polymer | 238.3 | 2 | Chemie (EPE) | |||
4 | A, B | N-(4-chloro-3-fluorophenyl)-N'-[(3aS,6aS)-hexahydrocyclopenta[c]pyrrol-3a(1H)-ylmethyl]ethanediamide | non-polymer | 339.8 | 2 | Chemie (0M4) | |||
5 | water | water | 18.0 | 231 | Chemie (HOH) |
Sequence modifications
A, B: 44 - 492 (UniProt: A0A0M3KKW9)
PDB | External Database | Details |
---|---|---|
Ser 375 | His 242 | engineered mutation |
Sequence viewer
Contents of the asymmetric unit
Polymers | Number of chains | 2 |
Total formula weight | 78320.7 | |
Non-Polymers* | Number of molecules | 24 |
Total formula weight | 5580.4 | |
All* | Total formula weight | 83901.1 |