4DKO
Crystal structure of clade A/E 93TH057 HIV-1 gp120 core in complex with TS-II-224
Entity
| Entity ID | Chain ID | Description | Type | Chain length | Formula weight | Number of molecules | DB Name (Accession) | Biological source | Descriptive keywords |
| 1 | A, B (A, C) | HIV-1 gp120 core | polymer | 353 | 39160.4 | 2 | UniProt (by SIFTS) (Q0ED31) | HUMAN IMMUNODEFICIENCY VIRUS TYPE 1 (HIV-1) | |
| 2 | C, D, E, F, G... (A, C) | 2-acetamido-2-deoxy-beta-D-glucopyranose | non-polymer | 221.2 | 22 | Chemie (NAG) | |||
| 3 | AA, N (C, A) | 4-(2-HYDROXYETHYL)-1-PIPERAZINE ETHANESULFONIC ACID | non-polymer | 238.3 | 2 | Chemie (EPE) | |||
| 4 | BA, O (C, A) | N-(4-chloro-3-fluorophenyl)-N'-(1,2,2,6,6-pentamethylpiperidin-4-yl)ethanediamide | non-polymer | 369.9 | 2 | Chemie (0LM) | |||
| 5 | CA, DA (A, C) | water | water | 18.0 | 394 | Chemie (HOH) |
Sequence viewer
Contents of the asymmetric unit
| Polymers | Number of chains | 2 |
| Total formula weight | 78320.7 | |
| Non-Polymers* | Number of molecules | 26 |
| Total formula weight | 6082.9 | |
| All* | Total formula weight | 84403.6 |






