7FX2
Crystal Structure of human FABP4 binding site mutated to that of FABP5 in complex with 2-[[6,6-difluoro-3-(4-methyl-1,3-thiazol-2-yl)-5,7-dihydro-4H-1-benzothiophen-2-yl]carbamoyl]cyclohexene-1-carboxylic acid, i.e. SMILES N(C(=O)C1=C(CCCC1)C(=O)O)C1=C(C2=NC(=CS2)C)C2=C(S1)CC(CC2)(F)F with IC50=0.0587459 microM
Functional Information from GO Data
| Chain | GOid | namespace | contents |
| A | 0005324 | molecular_function | long-chain fatty acid transmembrane transporter activity |
| A | 0005504 | molecular_function | fatty acid binding |
| A | 0005634 | cellular_component | nucleus |
| A | 0005737 | cellular_component | cytoplasm |
| A | 0005811 | cellular_component | lipid droplet |
| A | 0005829 | cellular_component | cytosol |
| A | 0008289 | molecular_function | lipid binding |
| A | 0009617 | biological_process | response to bacterium |
| A | 0015908 | biological_process | fatty acid transport |
| A | 0015909 | biological_process | long-chain fatty acid transport |
| A | 0036041 | molecular_function | long-chain fatty acid binding |
| A | 0042632 | biological_process | cholesterol homeostasis |
| A | 0045892 | biological_process | negative regulation of DNA-templated transcription |
| A | 0050729 | biological_process | positive regulation of inflammatory response |
| A | 0050872 | biological_process | white fat cell differentiation |
| A | 0050873 | biological_process | brown fat cell differentiation |
| A | 0051427 | molecular_function | hormone receptor binding |
| A | 0070062 | cellular_component | extracellular exosome |
| A | 0071285 | biological_process | cellular response to lithium ion |
| A | 0071356 | biological_process | cellular response to tumor necrosis factor |
| A | 0120162 | biological_process | positive regulation of cold-induced thermogenesis |
Functional Information from PROSITE/UniProt
| site_id | PS00214 |
| Number of Residues | 18 |
| Details | FABP Cytosolic fatty-acid binding proteins signature. GTWkLvsSeNFDdYMKEL |
| Chain | Residue | Details |
| A | GLY6-LEU23 |
Functional Information from SwissProt/UniProt
| site_id | SWS_FT_FI1 |
| Number of Residues | 1 |
| Details | BINDING: |
| Chain | Residue | Details |
| A | ARG126 |
| site_id | SWS_FT_FI2 |
| Number of Residues | 1 |
| Details | MOD_RES: N-acetylcysteine => ECO:0007744|PubMed:22223895 |
| Chain | Residue | Details |
| A | CYS1 |
| site_id | SWS_FT_FI3 |
| Number of Residues | 1 |
| Details | MOD_RES: Phosphoserine => ECO:0000250|UniProtKB:P04117 |
| Chain | Residue | Details |
| A | SER12 |
| site_id | SWS_FT_FI4 |
| Number of Residues | 1 |
| Details | MOD_RES: Phosphotyrosine; by Tyr-kinases => ECO:0000250 |
| Chain | Residue | Details |
| A | TYR19 |
