7FWN
Crystal Structure of human FABP4 in complex with 3-(5-methyl-2,3-diphenylindol-1-yl)propanoic acid, i.e. SMILES N1(C(=C(c2c1ccc(c2)C)c1ccccc1)c1ccccc1)CCC(=O)O with IC50=0.038 microM
Functional Information from GO Data
| Chain | GOid | namespace | contents |
| A | 0005319 | molecular_function | lipid transporter activity |
| A | 0005324 | molecular_function | long-chain fatty acid transmembrane transporter activity |
| A | 0005504 | molecular_function | fatty acid binding |
| A | 0005634 | cellular_component | nucleus |
| A | 0005737 | cellular_component | cytoplasm |
| A | 0005811 | cellular_component | lipid droplet |
| A | 0005829 | cellular_component | cytosol |
| A | 0008289 | molecular_function | lipid binding |
| A | 0015908 | biological_process | fatty acid transport |
| A | 0015909 | biological_process | long-chain fatty acid transport |
| A | 0019433 | biological_process | triglyceride catabolic process |
| A | 0036041 | molecular_function | long-chain fatty acid binding |
| A | 0051427 | molecular_function | hormone receptor binding |
| A | 0060229 | molecular_function | lipase activator activity |
| A | 0070062 | cellular_component | extracellular exosome |
| A | 0070343 | biological_process | white fat cell proliferation |
| A | 0120162 | biological_process | positive regulation of cold-induced thermogenesis |
Functional Information from PROSITE/UniProt
| site_id | PS00214 |
| Number of Residues | 18 |
| Details | FABP Cytosolic fatty-acid binding proteins signature. GTWkLvsSeNFDdYMKEV |
| Chain | Residue | Details |
| A | GLY6-VAL23 |
Functional Information from SwissProt/UniProt
| site_id | SWS_FT_FI1 |
| Number of Residues | 10 |
| Details | Motif: {"description":"Nuclear localization signal","evidences":[{"evidenceCode":"ECO:0000250"}]} |
| Chain | Residue | Details |
| site_id | SWS_FT_FI2 |
| Number of Residues | 2 |
| Details | Binding site: {} |
| Chain | Residue | Details |
| site_id | SWS_FT_FI3 |
| Number of Residues | 1 |
| Details | Modified residue: {"description":"N-acetylcysteine","evidences":[{"source":"PubMed","id":"22223895","evidenceCode":"ECO:0007744"}]} |
| Chain | Residue | Details |
| site_id | SWS_FT_FI4 |
| Number of Residues | 1 |
| Details | Modified residue: {"description":"Phosphoserine","evidences":[{"source":"UniProtKB","id":"P04117","evidenceCode":"ECO:0000250"}]} |
| Chain | Residue | Details |
| site_id | SWS_FT_FI5 |
| Number of Residues | 1 |
| Details | Modified residue: {"description":"Phosphotyrosine; by Tyr-kinases","evidences":[{"evidenceCode":"ECO:0000250"}]} |
| Chain | Residue | Details |






